Kopsanone
Internal ID | 0fe09e1a-e3df-46d2-b8e4-1502843d91a5 |
Taxonomy | Alkaloids and derivatives > Aspidofractine alkaloids |
IUPAC Name | 5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-17-one |
SMILES (Canonical) | C1CC23CCC45C(C2)C(=O)C6C4(C3N(C1)C6)C7=CC=CC=C7N5 |
SMILES (Isomeric) | C1CC23CCC45C(C2)C(=O)C6C4(C3N(C1)C6)C7=CC=CC=C7N5 |
InChI | InChI=1S/C20H22N2O/c23-16-13-10-18-6-3-9-22-11-14(16)20(17(18)22)12-4-1-2-5-15(12)21-19(13,20)8-7-18/h1-2,4-5,13-14,17,21H,3,6-11H2 |
InChI Key | RFDVSXYPLPEIGZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22N2O |
Molecular Weight | 306.40 g/mol |
Exact Mass | 306.173213330 g/mol |
Topological Polar Surface Area (TPSA) | 32.30 Ų |
XlogP | 2.20 |
DTXSID80330958 |
NSC340072 |
Q15426242 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.91% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.18% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.49% | 91.11% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.52% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.29% | 97.25% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.90% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 90.93% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.63% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.86% | 93.99% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.46% | 92.97% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.03% | 94.45% |
CHEMBL238 | Q01959 | Dopamine transporter | 85.60% | 95.88% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.53% | 90.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.31% | 94.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.87% | 99.23% |
CHEMBL240 | Q12809 | HERG | 83.71% | 89.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.00% | 86.33% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.71% | 93.04% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.09% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia arborea |
Kopsia fruticosa |
Kopsia hainanensis |
PubChem | 433961 |
LOTUS | LTS0086074 |
wikiData | Q15426242 |