Kodemariosides E
| Internal ID | 8365c925-213a-4ca7-a62d-de1333f27d71 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2Z)-2-[(4S,5R)-4-hydroxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]ethoxy]oxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC(=CC1C(C(=CCOC2C(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)O)O)O)O)C(=O)O1)O)C |
| SMILES (Isomeric) | CC(=C[C@@H]1[C@H](/C(=C/CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O)O)/C(=O)O1)O)C |
| InChI | InChI=1S/C25H30O12/c1-12(2)9-17-20(29)14(24(33)36-17)7-8-34-25-23(32)22(31)21(30)18(37-25)11-35-19(28)6-4-13-3-5-15(26)16(27)10-13/h3-7,9-10,17-18,20-23,25-27,29-32H,8,11H2,1-2H3/b6-4+,14-7-/t17-,18-,20+,21-,22+,23-,25-/m1/s1 |
| InChI Key | WKNWEGPLQYMFIH-WXFDPKOQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H30O12 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.17372639 g/mol |
| Topological Polar Surface Area (TPSA) | 192.00 Ų |
| XlogP | 0.00 |
| CHEMBL1088522 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.60% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.49% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.06% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.36% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.32% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.03% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.58% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.38% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.34% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.58% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.02% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spiraea cantoniensis |
| PubChem | 46833999 |
| LOTUS | LTS0100599 |
| wikiData | Q105307508 |