Kocurin
| Internal ID | 1f830cdf-bd00-47b2-b023-3f9035194acb |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[(6S,12S,15R,19S,26S)-26-(2-amino-2-oxoethyl)-19-benzyl-12-[(4-hydroxyphenyl)methyl]-30-methyl-11,14,21,28-tetraoxo-31-oxa-4,17,24,41-tetrathia-10,13,20,27,37,42,43,44,45,46-decazaoctacyclo[37.2.1.12,5.115,18.122,25.129,32.06,10.033,38]hexatetraconta-1(42),2,5(46),18(45),22,25(44),29,32(43),33(38),34,36,39-dodecaen-36-yl]-N-[3-[[(2S)-1-[(2S)-2-[[3-[(3-amino-3-oxoprop-1-en-2-yl)amino]-3-oxoprop-1-en-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-3-oxoprop-1-en-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | CC1=C2C(=O)NC(C3=NC(=CS3)C(=O)NC(C4=NC(CS4)C(=O)NC(C(=O)N5CCCC5C6=NC(=CS6)C7=NC(=CS7)C8=C(C=CC(=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)NC(C)C(=O)N3CCCC3C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C(=N2)O1)CC1=CC=C(C=C1)O)CC1=CC=CC=C1)CC(=O)N |
| SMILES (Isomeric) | CC1=C2C(=O)N[C@H](C3=NC(=CS3)C(=O)N[C@H](C4=N[C@@H](CS4)C(=O)N[C@H](C(=O)N5CCC[C@H]5C6=NC(=CS6)C7=NC(=CS7)C8=C(C=CC(=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)N[C@@H](C)C(=O)N3CCC[C@H]3C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C(=N2)O1)CC1=CC=C(C=C1)O)CC1=CC=CC=C1)CC(=O)N |
| InChI | InChI=1S/C69H66N18O13S5/c1-31(54(71)90)72-55(91)33(3)74-60(96)49-13-9-21-86(49)68(98)34(4)75-56(92)32(2)73-57(93)45-27-102-63(81-45)40-20-19-39-53(76-40)44-26-101-66(80-44)48-30-105-67(84-48)50-14-10-22-87(50)69(99)43(24-37-15-17-38(88)18-16-37)79-59(95)47-29-103-64(82-47)41(23-36-11-7-6-8-12-36)77-58(94)46-28-104-65(83-46)42(25-51(70)89)78-61(97)52-35(5)100-62(39)85-52/h6-8,11-12,15-20,26-28,30,34,41-43,47,49-50,88H,1-3,9-10,13-14,21-25,29H2,4-5H3,(H2,70,89)(H2,71,90)(H,72,91)(H,73,93)(H,74,96)(H,75,92)(H,77,94)(H,78,97)(H,79,95)/t34-,41-,42-,43-,47-,49-,50-/m0/s1 |
| InChI Key | WWWYMYPACSXBTM-GVYUJTEBSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C69H66N18O13S5 |
| Molecular Weight | 1515.70 g/mol |
| Exact Mass | 1514.36603010 g/mol |
| Topological Polar Surface Area (TPSA) | 592.00 Ų |
| XlogP | 4.10 |
| Atomic LogP (AlogP) | 4.67 |
| H-Bond Acceptor | 25 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 17 |
| AKOS040756174 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5166 | 51.66% |
| Caco-2 | - | 0.8613 | 86.13% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.6903 | 69.03% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8040 | 80.40% |
| OATP1B3 inhibitior | + | 0.9242 | 92.42% |
| MATE1 inhibitior | - | 0.8400 | 84.00% |
| OCT2 inhibitior | - | 0.7878 | 78.78% |
| BSEP inhibitior | + | 0.9764 | 97.64% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8621 | 86.21% |
| CYP3A4 substrate | + | 0.7614 | 76.14% |
| CYP2C9 substrate | + | 0.5968 | 59.68% |
| CYP2D6 substrate | - | 0.8671 | 86.71% |
| CYP3A4 inhibition | - | 0.7661 | 76.61% |
| CYP2C9 inhibition | - | 0.7512 | 75.12% |
| CYP2C19 inhibition | - | 0.7054 | 70.54% |
| CYP2D6 inhibition | - | 0.8688 | 86.88% |
| CYP1A2 inhibition | - | 0.7726 | 77.26% |
| CYP2C8 inhibition | + | 0.8666 | 86.66% |
| CYP inhibitory promiscuity | - | 0.8809 | 88.09% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9400 | 94.00% |
| Carcinogenicity (trinary) | Non-required | 0.5621 | 56.21% |
| Eye corrosion | - | 0.9834 | 98.34% |
| Eye irritation | - | 0.8957 | 89.57% |
| Skin irritation | - | 0.7621 | 76.21% |
| Skin corrosion | - | 0.9188 | 91.88% |
| Ames mutagenesis | - | 0.6000 | 60.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7091 | 70.91% |
| Micronuclear | + | 0.8500 | 85.00% |
| Hepatotoxicity | + | 0.5500 | 55.00% |
| skin sensitisation | - | 0.8345 | 83.45% |
| Respiratory toxicity | + | 0.9000 | 90.00% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9250 | 92.50% |
| Nephrotoxicity | - | 0.7111 | 71.11% |
| Acute Oral Toxicity (c) | III | 0.6001 | 60.01% |
| Estrogen receptor binding | - | 0.5232 | 52.32% |
| Androgen receptor binding | + | 0.7801 | 78.01% |
| Thyroid receptor binding | + | 0.7993 | 79.93% |
| Glucocorticoid receptor binding | + | 0.8298 | 82.98% |
| Aromatase binding | + | 0.7965 | 79.65% |
| PPAR gamma | + | 0.7784 | 77.84% |
| Honey bee toxicity | - | 0.6125 | 61.25% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
| Fish aquatic toxicity | + | 0.9614 | 96.14% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
| CHEMBL204 | P00734 | Thrombin | 98.92% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.24% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.20% | 97.64% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 98.03% | 97.53% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 97.89% | 93.03% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.81% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.87% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.47% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.24% | 99.23% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 91.66% | 87.50% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.48% | 82.38% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 90.92% | 80.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.78% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.68% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.30% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.44% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.26% | 99.18% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.95% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.28% | 99.15% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.97% | 96.21% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.78% | 100.00% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 87.63% | 96.76% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.56% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 87.22% | 98.33% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.07% | 91.76% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.04% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.13% | 90.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.87% | 85.11% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.46% | 95.00% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.35% | 95.34% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.90% | 95.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.66% | 91.19% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 84.12% | 82.86% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.94% | 96.47% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.15% | 83.82% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.83% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.79% | 86.33% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 81.82% | 88.42% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.70% | 96.67% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.32% | 82.69% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.70% | 94.00% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.62% | 99.29% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.00% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71816533 |
| LOTUS | LTS0229295 |
| wikiData | Q77512349 |