Keratinicyclin C
| Internal ID | 59d57df1-3ad6-412c-abe5-e78000463a51 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (1S,2R,18R,22R,25S,28R,31R,43S)-51-[(2S,3R,4S,5S,6R)-3-[(2S,4S,5R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-[(2R,4S,5R,6S)-4-amino-5-methoxy-6-methyloxan-2-yl]oxy-25-benzyl-5-chloro-35,38,40-trihydroxy-20,23,26,29,45,47-hexaoxo-7,13,19-trioxa-21,24,27,30,44,46-hexazanonacyclo[29.14.2.23,6.214,17.18,12.132,36.010,28.018,22.037,42]tripentaconta-3,5,8,10,12(51),14(50),15,17(49),32(48),33,35,37(42),38,40,52-pentadecaene-43-carboxylic acid |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)C(C7C(=O)NC(C8=C(C(=CC(=C8)O)O)C9=C(C=CC(=C9)C(C(=O)N7)NC(=O)C5NC(=O)C(NC(=O)C1C(C2=CC=C(O4)C=C2)OC(=O)N1)CC1=CC=CC=C1)O)C(=O)O)OC1CC(C(C(O1)C)OC)N)Cl)CO)O)O)N)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2[C@H]3C(=O)N[C@@H](C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)[C@H](C(=O)N3)NC(=O)[C@H]6C7=CC(=C(C(=C7)OC8=C(C=C2C=C8)Cl)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O[C@H]1C[C@@H]([C@H](C(O1)C)O)N)OC1=CC=C(C=C1)[C@@H]1[C@H](C(=O)N[C@H](C(=O)N6)CC2=CC=CC=C2)NC(=O)O1)O)C(=O)O)N)OC |
| InChI | InChI=1S/C71H75ClN8O25/c1-27-56(85)39(73)24-48(97-27)103-63-58(87)57(86)47(26-81)101-70(63)104-62-45-20-33-21-46(62)100-44-16-12-32(19-38(44)72)61(102-49-25-40(74)59(96-3)28(2)98-49)54-68(92)78-53(69(93)94)37-22-34(82)23-43(84)50(37)36-18-31(11-15-42(36)83)51(65(89)79-54)77-66(90)52(33)76-64(88)41(17-29-7-5-4-6-8-29)75-67(91)55-60(105-71(95)80-55)30-9-13-35(99-45)14-10-30/h4-16,18-23,27-28,39-41,47-49,51-61,63,70,81-87H,17,24-26,73-74H2,1-3H3,(H,75,91)(H,76,88)(H,77,90)(H,78,92)(H,79,89)(H,80,95)(H,93,94)/t27?,28-,39-,40-,41-,47+,48-,49-,51+,52+,53-,54-,55+,56-,57+,58-,59-,60+,61+,63+,70-/m0/s1 |
| InChI Key | NCGSJZWZGVQTMS-XHASBCFDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C71H75ClN8O25 |
| Molecular Weight | 1475.80 g/mol |
| Exact Mass | 1474.4531876 g/mol |
| Topological Polar Surface Area (TPSA) | 498.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.30% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 99.11% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.40% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.28% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.88% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.75% | 99.15% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 94.34% | 97.31% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.76% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.02% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.92% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.16% | 94.00% |
| CHEMBL204 | P00734 | Thrombin | 88.96% | 96.01% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.83% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.21% | 91.49% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.56% | 95.93% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.45% | 97.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.29% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.03% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.63% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.20% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.36% | 92.62% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 81.44% | 95.48% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.42% | 80.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.14% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683567 |
| LOTUS | LTS0127747 |
| wikiData | Q105177192 |