Kaur-15-ene, (5alpha,9alpha,10beta)-
| Internal ID | 697b116f-a776-4f3e-8a71-789c0c039734 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (4S,9S,10R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene |
| SMILES (Canonical) | CC1=CC23CCC4C(CCCC4(C2CCC1C3)C)(C)C |
| SMILES (Isomeric) | CC1=CC23CC[C@@H]4[C@@]([C@H]2CCC1C3)(CCCC4(C)C)C |
| InChI | InChI=1S/C20H32/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h12,15-17H,5-11,13H2,1-4H3/t15?,16-,17+,19-,20?/m0/s1 |
| InChI Key | DQUHDYWUEKWRLN-JOQVEUFWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.250401021 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 6.90 |
| Kaur-15-ene, (5.alpha.,9.alpha.,10.beta.)- |
| Isophyllocladene |
| Isophyllocladen |
| (+)-Isophyllocladene |
| Kaur-15-ene # |
| Isophyllocladene, (+)- |
| DQUHDYWUEKWRLN-JOQVEUFWSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.01% | 97.25% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.34% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.10% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.42% | 82.69% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.74% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.43% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.21% | 95.89% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.55% | 86.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.24% | 95.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.67% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.95% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.56% | 95.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.79% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bazzania japonica |
| Halocarpus bidwillii |
| Halocarpus biformis |
| PubChem | 6432491 |
| LOTUS | LTS0037794 |
| wikiData | Q104253493 |