Kahakamide A
Internal ID | 8bbb3292-b865-4a48-9b3f-70f9450baa68 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glucuronides > N-glucuronides |
IUPAC Name | methyl (2S,4S,5S,6S)-6-[3-(2-amino-2-oxoethyl)-4-methoxyindol-1-yl]-4,5-dihydroxyoxane-2-carboxylate |
SMILES (Canonical) | COC1=CC=CC2=C1C(=CN2C3C(C(CC(O3)C(=O)OC)O)O)CC(=O)N |
SMILES (Isomeric) | COC1=CC=CC2=C1C(=CN2[C@@H]3[C@H]([C@H](C[C@H](O3)C(=O)OC)O)O)CC(=O)N |
InChI | InChI=1S/C18H22N2O7/c1-25-12-5-3-4-10-15(12)9(6-14(19)22)8-20(10)17-16(23)11(21)7-13(27-17)18(24)26-2/h3-5,8,11,13,16-17,21,23H,6-7H2,1-2H3,(H2,19,22)/t11-,13-,16-,17-/m0/s1 |
InChI Key | YMYPXKZOERIPRK-SCTFDZSOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H22N2O7 |
Molecular Weight | 378.40 g/mol |
Exact Mass | 378.14270105 g/mol |
Topological Polar Surface Area (TPSA) | 133.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.01% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.01% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.60% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.21% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.14% | 91.11% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.67% | 89.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.09% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.78% | 97.25% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.14% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.03% | 95.89% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.90% | 94.45% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.18% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 86.52% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 86.39% | 98.95% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 85.81% | 94.05% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.95% | 94.00% |
CHEMBL3891 | P07384 | Calpain 1 | 82.31% | 93.04% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.11% | 97.21% |
CHEMBL5028 | O14672 | ADAM10 | 82.06% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.83% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.72% | 99.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.45% | 94.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.38% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.55% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
PubChem | 10339609 |
LOTUS | LTS0062412 |
wikiData | Q105262822 |