Kaempferol 4'-glucoside 7-rhamnoside
Internal ID | 5ef0eb9e-cfc1-4021-9b02-8dde63213d79 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3,5-dihydroxy-2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O15/c1-9-17(30)20(33)23(36)26(38-9)40-12-6-13(29)16-14(7-12)41-25(22(35)19(16)32)10-2-4-11(5-3-10)39-27-24(37)21(34)18(31)15(8-28)42-27/h2-7,9,15,17-18,20-21,23-24,26-31,33-37H,8H2,1H3 |
InChI Key | FYZRTNFFTKNBKH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.60 |
7-[(6-Deoxy-alpha-L-mannopyranosyl)oxy]-2-[4-(beta-D-glucopyranosyloxy)phenyl]-3,5-dihydroxy-4H-1-benzopyran-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.97% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.77% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.15% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.95% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.87% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.06% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.20% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.57% | 86.92% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.26% | 95.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.08% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.01% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.48% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.24% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.43% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.67% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.22% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.17% | 90.71% |
CHEMBL3194 | P02766 | Transthyretin | 80.44% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.11% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pteridium aquilinum |
PubChem | 74978093 |
LOTUS | LTS0231036 |
wikiData | Q105004817 |