Kaempferol 3-O-xylosyl-rutinoside
Internal ID | 7fc53aa1-bf82-48b6-80d1-9ba823840b96 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OCC3C(C(C(C(O3)OC4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O)O)O)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@H]([C@@H]2O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O)O)O)C)O)O)O)O |
InChI | InChI=1S/C33H40O19/c1-10-19(37)23(41)25(43)32(48-10)51-29-20(38)11(2)47-31(27(29)45)46-9-17-21(39)24(42)26(44)33(50-17)52-30-22(40)18-15(36)7-14(35)8-16(18)49-28(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,29,31-39,41-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21+,23+,24-,25+,26+,27+,29+,31+,32-,33-/m0/s1 |
InChI Key | UYVBMGULWGRDQT-VLYLGZBPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O19 |
Molecular Weight | 740.70 g/mol |
Exact Mass | 740.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -2.00 |
DTXSID801341629 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.80% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.29% | 91.49% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.67% | 95.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.62% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.39% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.59% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.87% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.67% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.67% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.11% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.26% | 95.78% |
CHEMBL3194 | P02766 | Transthyretin | 82.71% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.49% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.46% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.72% | 95.89% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.52% | 98.35% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.18% | 97.36% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.06% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia reticulata |
Phaseolus vulgaris |
PubChem | 101502553 |
LOTUS | LTS0178575 |
wikiData | Q105281967 |