Kaempferol-3-O-(apiofuranosyl-(1'''-2''))-galactopyranoside
Internal ID | fd5befc9-5e6e-4012-8da5-6d947a918298 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5R,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1C(C(C(O1)OC2C(C(C(OC2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)CO)O)O)O)(CO)O |
SMILES (Isomeric) | C1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)CO)O)O)O)(CO)O |
InChI | InChI=1S/C26H28O15/c27-7-15-17(32)19(34)22(41-25-23(35)26(36,8-28)9-37-25)24(39-15)40-21-18(33)16-13(31)5-12(30)6-14(16)38-20(21)10-1-3-11(29)4-2-10/h1-6,15,17,19,22-25,27-32,34-36H,7-9H2/t15-,17+,19+,22-,23+,24+,25+,26-/m1/s1 |
InChI Key | MNBRHJWOHPGQIW-QLAXZGQUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H28O15 |
Molecular Weight | 580.50 g/mol |
Exact Mass | 580.14282018 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.50 |
Kaempferol-3-O-(apiofuranosyl-(1'''-2''))-galactopyranoside |
3-Kafg |
3-kaempferol-apiofur-Gal |
3-[(2S,3R,4S,5R,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
DTXSID60157463 |
kaempferol-3-O-(apiofuranosyl-(1/'/'/'-2/'/'))-galactopyranoside |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.87% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.81% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.45% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.05% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.83% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.20% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.52% | 95.93% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.55% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.47% | 86.33% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 86.89% | 98.35% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.08% | 99.15% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.05% | 94.75% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 85.22% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.47% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.37% | 95.83% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.96% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.54% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.52% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.14% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.82% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.77% | 95.64% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.74% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.13% | 90.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.07% | 80.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.78% | 97.28% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 80.37% | 96.69% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.32% | 95.53% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.27% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.08% | 95.78% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.02% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chenopodium quinoa |
PubChem | 5492472 |
LOTUS | LTS0010568 |
wikiData | Q83025602 |