Justicidin H
| Internal ID | 59258b14-fec5-4f3d-815f-c9e059336d46 |
| Taxonomy | Lignans, neolignans and related compounds > Arylnaphthalene lignans |
| IUPAC Name | 4-(6-hydroxy-1,3-benzodioxol-5-yl)-6,7-dimethoxy-1H-benzo[f][2]benzofuran-3-one |
| SMILES (Canonical) | COC1=CC2=CC3=C(C(=C2C=C1OC)C4=CC5=C(C=C4O)OCO5)C(=O)OC3 |
| SMILES (Isomeric) | COC1=CC2=CC3=C(C(=C2C=C1OC)C4=CC5=C(C=C4O)OCO5)C(=O)OC3 |
| InChI | InChI=1S/C21H16O7/c1-24-15-4-10-3-11-8-26-21(23)19(11)20(12(10)5-16(15)25-2)13-6-17-18(7-14(13)22)28-9-27-17/h3-7,22H,8-9H2,1-2H3 |
| InChI Key | NXDFXQJRGLAEKK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H16O7 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.08960285 g/mol |
| Topological Polar Surface Area (TPSA) | 83.40 Ų |
| XlogP | 3.60 |
| 6'-Hydroxyjusticidin B |
| TE3TZ0U12Z |
| 145726-39-2 |
| Naphtho(2,3-c)furan-1(3H)-one, 9-(6-hydroxy-1,3-benzodioxol-5-yl)-6,7-dimethoxy- |
| UNII-TE3TZ0U12Z |
| DTXSID80163147 |
| Q27289920 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.73% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.79% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.62% | 98.75% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.47% | 96.21% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.12% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.05% | 92.62% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.21% | 96.77% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.66% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.07% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.09% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.06% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.00% | 82.67% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 84.49% | 98.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.97% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.34% | 90.00% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.26% | 92.38% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.54% | 99.15% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.74% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.23% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.77% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.34% | 94.73% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.10% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Justicia procumbens |
| PubChem | 60194680 |
| LOTUS | LTS0202464 |
| wikiData | Q27289920 |