Julibroside II
Internal ID | 4effd310-55d7-4e9f-ab5c-ea714a74ff5c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [3-[5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,4aR,5R,6aR,6bR,10S,12aR)-10-[6-[[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[(2E,6S)-6-[5-[(2E,6S)-2,6-dimethyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyocta-2,7-dienoyl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC(C)(CCC=C(C)C(=O)OC2C(OC(C(C2O)O)OC(C)(CCC=C(C)C(=O)OC3CC4(C(CC3(C)C)C5CCC6C7(CCC(C(C7CCC6(C5(CC4O)C)C)(C)C)OC8C(C(C(C(O8)COC9C(C(C(C(O9)C)O)O)OC1C(C(C(CO1)O)O)O)O)O)O)C)C(=O)OC1C(C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)C)OC1C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)C=C)C)C=C)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)O[C@@](C)(CC/C=C(\C)/C(=O)OC2C(OC(C(C2O)O)O[C@@](C)(CC/C=C(\C)/C(=O)O[C@H]3C[C@@]4([C@@H](C[C@@]5(C(C4CC3(C)C)CCC6[C@]5(CCC7[C@@]6(CC[C@@H](C7(C)C)OC8C(C(C(C(O8)COC9C(C(C(C(O9)C)O)O)OC1C(C(C(CO1)O)O)O)O)O)O)C)C)C)O)C(=O)OC1C(C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)C)OC1C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)C=C)C)C=C)O)O)O |
InChI | InChI=1S/C102H164O48/c1-18-97(13,149-90-75(125)65(115)58(108)42(5)133-90)29-21-23-41(4)84(129)143-78-44(7)136-91(76(126)70(78)120)150-98(14,19-2)28-20-22-40(3)83(128)141-57-34-102(94(130)148-93-82(69(119)62(112)50(36-104)139-93)147-89-77(127)80(145-88-74(124)66(116)61(111)49(35-103)137-88)79(45(8)135-89)144-87-72(122)63(113)51(37-105)138-87)47(32-95(57,9)10)46-24-25-54-99(15)30-27-56(96(11,12)53(99)26-31-100(54,16)101(46,17)33-55(102)107)142-86-73(123)67(117)64(114)52(140-86)39-132-92-81(68(118)59(109)43(6)134-92)146-85-71(121)60(110)48(106)38-131-85/h18-19,22-23,42-82,85-93,103-127H,1-2,20-21,24-39H2,3-17H3/b40-22+,41-23+/t42?,43?,44?,45?,46?,47?,48?,49?,50?,51?,52?,53?,54?,55-,56+,57+,58?,59?,60?,61?,62?,63?,64?,65?,66?,67?,68?,69?,70?,71?,72?,73?,74?,75?,76?,77?,78?,79?,80?,81?,82?,85?,86?,87?,88?,89?,90?,91?,92?,93?,97-,98-,99+,100-,101-,102-/m1/s1 |
InChI Key | KSJRKVPYZNVROG-LNKJTTDOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C102H164O48 |
Molecular Weight | 2158.40 g/mol |
Exact Mass | 2158.0425618 g/mol |
Topological Polar Surface Area (TPSA) | 742.00 Ų |
XlogP | -1.50 |
Atomic LogP (AlogP) | -5.08 |
H-Bond Acceptor | 48 |
H-Bond Donor | 25 |
Rotatable Bonds | 34 |
NSC722902 |
NSC-722902 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7725 | 77.25% |
Caco-2 | - | 0.8561 | 85.61% |
Blood Brain Barrier | - | 0.5500 | 55.00% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.8234 | 82.34% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.7777 | 77.77% |
OATP1B3 inhibitior | + | 0.8709 | 87.09% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.6000 | 60.00% |
BSEP inhibitior | + | 0.9572 | 95.72% |
P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
P-glycoprotein substrate | + | 0.7592 | 75.92% |
CYP3A4 substrate | + | 0.7631 | 76.31% |
CYP2C9 substrate | - | 0.8028 | 80.28% |
CYP2D6 substrate | - | 0.8775 | 87.75% |
CYP3A4 inhibition | - | 0.7760 | 77.60% |
CYP2C9 inhibition | - | 0.8148 | 81.48% |
CYP2C19 inhibition | - | 0.8933 | 89.33% |
CYP2D6 inhibition | - | 0.9384 | 93.84% |
CYP1A2 inhibition | - | 0.9028 | 90.28% |
CYP2C8 inhibition | + | 0.8285 | 82.85% |
CYP inhibitory promiscuity | - | 0.9484 | 94.84% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5711 | 57.11% |
Eye corrosion | - | 0.9887 | 98.87% |
Eye irritation | - | 0.8954 | 89.54% |
Skin irritation | + | 0.5086 | 50.86% |
Skin corrosion | - | 0.9351 | 93.51% |
Ames mutagenesis | - | 0.6000 | 60.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7303 | 73.03% |
Micronuclear | - | 0.8200 | 82.00% |
Hepatotoxicity | - | 0.5798 | 57.98% |
skin sensitisation | - | 0.8940 | 89.40% |
Respiratory toxicity | + | 0.6444 | 64.44% |
Reproductive toxicity | + | 0.8889 | 88.89% |
Mitochondrial toxicity | + | 0.5750 | 57.50% |
Nephrotoxicity | - | 0.9551 | 95.51% |
Acute Oral Toxicity (c) | III | 0.4931 | 49.31% |
Estrogen receptor binding | - | 0.5539 | 55.39% |
Androgen receptor binding | + | 0.7712 | 77.12% |
Thyroid receptor binding | + | 0.8011 | 80.11% |
Glucocorticoid receptor binding | + | 0.8451 | 84.51% |
Aromatase binding | + | 0.7959 | 79.59% |
PPAR gamma | + | 0.8019 | 80.19% |
Honey bee toxicity | - | 0.5782 | 57.82% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9823 | 98.23% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.19% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.08% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.15% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.95% | 95.93% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.90% | 97.36% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.90% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.79% | 86.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.44% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.35% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.64% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.52% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.36% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.06% | 93.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.00% | 92.94% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.18% | 92.88% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.14% | 95.71% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.00% | 96.90% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.39% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.63% | 93.04% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.31% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 85.29% | 97.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.17% | 97.86% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.63% | 98.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.39% | 92.50% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.27% | 95.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.14% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.80% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.01% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.26% | 96.43% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 81.90% | 97.34% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.79% | 94.33% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.60% | 100.00% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.33% | 85.83% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.11% | 94.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.07% | 100.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.83% | 97.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.83% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.70% | 91.19% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.63% | 96.95% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.50% | 97.29% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.32% | 86.92% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.20% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 5352114 |
NPASS | NPC45485 |
LOTUS | LTS0193140 |
wikiData | Q105145445 |