Julibrine II
Internal ID | 93cbcc2e-b8cb-4576-9929-dcd5261bc12f |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridoxines |
IUPAC Name | 5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-6-[[5-hydroxy-4-(methoxymethyl)-6-methylpyridin-3-yl]methoxy]-2-(hydroxymethyl)oxane-3,4-diol |
SMILES (Canonical) | CC1=NC=C(C(=C1O)COC)COC2C(C(C(C(O2)CO)O)O)OC3C(C(CO3)(CO)O)O |
SMILES (Isomeric) | CC1=NC=C(C(=C1O)COC)COC2C(C(C(C(O2)CO)O)O)OC3C(C(CO3)(CO)O)O |
InChI | InChI=1S/C20H31NO12/c1-9-13(24)11(6-29-2)10(3-21-9)5-30-18-16(15(26)14(25)12(4-22)32-18)33-19-17(27)20(28,7-23)8-31-19/h3,12,14-19,22-28H,4-8H2,1-2H3 |
InChI Key | OGMDYCDHLSLDDN-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H31NO12 |
Molecular Weight | 477.50 g/mol |
Exact Mass | 477.18462542 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | -3.20 |
142628-29-3 |
5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-6-[[5-hydroxy-4-(methoxymethyl)-6-methylpyridin-3-yl]methoxy]-2-(hydroxymethyl)oxane-3,4-diol |
DTXSID90931551 |
AKOS040745915 |
3-Hydroxy-5-hydroxymethyl-4-methoxy-methyl-2-methylpyridine 5'-O-beta-apiofuranosyl(1-2)beta-glucopyranoside |
[5-Hydroxy-4-(methoxymethyl)-6-methylpyridin-3-yl]methyl 2-O-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]hexopyranoside |
beta-D-Glucopyranoside, (5-hydroxy-4-(methoxymethyl)-6-methyl-3-pyridinyl)methyl 2-O-D-apio-beta-D-furanosyl- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.96% | 91.11% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 96.79% | 97.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.71% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.51% | 94.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 94.34% | 97.53% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.62% | 95.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.97% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.53% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.00% | 94.73% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.70% | 97.47% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.96% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.86% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.47% | 86.33% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.54% | 93.10% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.42% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.98% | 96.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.19% | 92.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.32% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.11% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.30% | 94.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.91% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.76% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.59% | 90.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.52% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 196917 |
LOTUS | LTS0065896 |
wikiData | Q82907113 |