Isosolanidine
Internal ID | 3e581002-ed08-4755-add9-47c33afefeb6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Solanidines and derivatives |
IUPAC Name | (1S,2S,7S,10R,11S,14S,15R,16S,17S,20R,23S)-10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-en-7-ol |
SMILES (Canonical) | CC1CCC2C(C3C(N2C1)CC4C3(CCC5C4CC=C6C5(CCC(C6)O)C)C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O)C)C)C |
InChI | InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17-,19+,20-,21+,22+,23+,24+,25+,26+,27+/m1/s1 |
InChI Key | JVKYZPBMZPJNAJ-XPMUQOCRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H43NO |
Molecular Weight | 397.60 g/mol |
Exact Mass | 397.334464995 g/mol |
Topological Polar Surface Area (TPSA) | 23.50 Ų |
XlogP | 6.10 |
Isosolanidine |
566-09-6 |
(22S,25R)-Solanid-5-en-3beta-ol |
(22S,25R)-Solanid-5-en-3-beta-ol |
Solanid-5-en-3-beta-ol, (22S,25R)- |
Solanid-5-en-3-ol, (3-beta,22-beta,25-beta)- |
SCHEMBL3500583 |
DTXSID70861645 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4931 | Q15125 | 3-beta-hydroxysteroid-delta(8),delta(7)-isomerase |
441 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.34% | 96.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 95.42% | 89.05% |
CHEMBL238 | Q01959 | Dopamine transporter | 91.79% | 95.88% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.44% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.25% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.20% | 97.09% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 90.56% | 86.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.30% | 95.93% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.78% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 88.69% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.54% | 86.33% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.00% | 96.43% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.85% | 91.11% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.67% | 98.46% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.05% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.33% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.33% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.96% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.73% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.72% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.52% | 93.56% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.06% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum tuberosum |
PubChem | 160527 |
LOTUS | LTS0085922 |
wikiData | Q105135806 |