Isosafrole glycol
| Internal ID | 79a6d089-707e-4299-8284-04c26dd8bf79 |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)propane-1,2-diol |
| SMILES (Canonical) | CC(C(C1=CC2=C(C=C1)OCO2)O)O |
| SMILES (Isomeric) | CC(C(C1=CC2=C(C=C1)OCO2)O)O |
| InChI | InChI=1S/C10H12O4/c1-6(11)10(12)7-2-3-8-9(4-7)14-5-13-8/h2-4,6,10-12H,5H2,1H3 |
| InChI Key | YIRAEUKOPKEBHB-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 0.80 |
| RefChem:1052400 |
| Isosafrole glycol |
| 62512-79-2 |
| 1-(2H-1,3-BENZODIOXOL-5-YL)PROPANE-1,2-DIOL |
| SCHEMBL10931500 |
| DTXSID60978110 |
| YIRAEUKOPKEBHB-UHFFFAOYSA-N |
| 4-(1,2-dihydroxy-propyl)-1,2-methylenedioxybenzene |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 96.05% | 94.80% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.39% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.50% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.91% | 91.11% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 93.87% | 92.51% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.61% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.21% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.35% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.46% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.32% | 90.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.25% | 94.73% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.98% | 100.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.57% | 80.96% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.81% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.34% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.09% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Illicium dunnianum |
| PubChem | 6454417 |
| LOTUS | LTS0132576 |
| wikiData | Q82963448 |