Isopteleflorine
| Internal ID | 29e1de06-fd3c-4b36-8489-b848d39b1a20 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
| IUPAC Name | 2-[(13R)-10-methoxy-3,5,14-trioxa-16-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),7,10,15-pentaen-13-yl]propan-2-ol |
| SMILES (Canonical) | CC(C)(C1CC2=C(C3=C(C4=C(C=C3)OCO4)N=C2O1)OC)O |
| SMILES (Isomeric) | CC(C)([C@H]1CC2=C(C3=C(C4=C(C=C3)OCO4)N=C2O1)OC)O |
| InChI | InChI=1S/C16H17NO5/c1-16(2,18)11-6-9-13(19-3)8-4-5-10-14(21-7-20-10)12(8)17-15(9)22-11/h4-5,11,18H,6-7H2,1-3H3/t11-/m1/s1 |
| InChI Key | LKRBBZYDDUUFNV-LLVKDONJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11067264 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 2.30 |
| 174513-97-4 |
| DTXSID20169845 |
| 2-[(13R)-10-methoxy-3,5,14-trioxa-16-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),7,10,15-pentaen-13-yl]propan-2-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.27% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.36% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.21% | 92.62% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.54% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.99% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.19% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.01% | 86.33% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.23% | 82.67% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 86.93% | 80.96% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.33% | 96.09% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.63% | 95.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.07% | 97.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.83% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.58% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.02% | 94.73% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 80.72% | 95.39% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.57% | 96.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.24% | 96.39% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.19% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Orixa japonica |
| PubChem | 197708 |
| LOTUS | LTS0194345 |
| wikiData | Q83039625 |