Isoprosopilosidine
Internal ID | b290a797-9ee0-4260-a5e4-b09b0c3b4580 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | (2R,3R,6S)-6-[10-[8-[10-[(2R,5R,6S)-5-hydroxy-6-methylpiperidin-2-yl]decyl]-2,3-dihydro-1H-indolizin-4-ium-6-yl]decyl]-2-methylpiperidin-3-ol |
SMILES (Canonical) | CC1C(CCC(N1)CCCCCCCCCCC2=CC(=C3CCC[N+]3=C2)CCCCCCCCCCC4CCC(C(N4)C)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H](CC[C@@H](N1)CCCCCCCCCCC2=CC(=C3CCC[N+]3=C2)CCCCCCCCCC[C@@H]4CC[C@H]([C@@H](N4)C)O)O |
InChI | InChI=1S/C40H72N3O2/c1-32-39(44)27-25-36(41-32)22-17-13-9-5-3-7-11-15-20-34-30-35(38-24-19-29-43(38)31-34)21-16-12-8-4-6-10-14-18-23-37-26-28-40(45)33(2)42-37/h30-33,36-37,39-42,44-45H,3-29H2,1-2H3/q+1/t32-,33+,36+,37-,39-,40-/m1/s1 |
InChI Key | ZSATVXRUAGIIJL-NMHXFYNSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H72N3O2+ |
Molecular Weight | 627.00 g/mol |
Exact Mass | 626.56245355 g/mol |
Topological Polar Surface Area (TPSA) | 68.40 Ų |
XlogP | 10.80 |
CHEMBL541962 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.03% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.97% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.65% | 95.50% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.50% | 99.18% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.59% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.27% | 95.93% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.87% | 93.99% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.73% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.13% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.09% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.38% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.19% | 100.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.98% | 83.57% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.69% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.79% | 92.94% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.42% | 91.43% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.63% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prosopis glandulosa |
PubChem | 44157065 |
LOTUS | LTS0235355 |
wikiData | Q105382383 |