Isolushinin B
Internal ID | 9b4b9229-8230-4cea-b625-970bcfa5b833 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1R,2S,5R,7R,8S,9R,10S,11R,12R)-7,9,10-trihydroxy-12-methyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCCC23C1C(C(C45C2CCC(C4)C(=C)C5O)(OC3)O)O)C |
SMILES (Isomeric) | CC(=O)OC[C@@]1(CCC[C@]23[C@@H]1[C@@H]([C@@]([C@]45[C@H]2CC[C@H](C4)C(=C)[C@H]5O)(OC3)O)O)C |
InChI | InChI=1S/C22H32O6/c1-12-14-5-6-15-20-8-4-7-19(3,10-27-13(2)23)16(20)18(25)22(26,28-11-20)21(15,9-14)17(12)24/h14-18,24-26H,1,4-11H2,2-3H3/t14-,15+,16-,17-,18+,19+,20-,21+,22+/m1/s1 |
InChI Key | FYDTXJOBJMQQRB-XOWWTGBZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H32O6 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 1.30 |
CHEMBL1163544 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.94% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.11% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.88% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.65% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.35% | 98.95% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.45% | 95.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.22% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.92% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.44% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.92% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.07% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.55% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.97% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.51% | 91.19% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.25% | 97.28% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.88% | 92.94% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.84% | 95.71% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.38% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.94% | 94.75% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.55% | 82.69% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 80.48% | 90.48% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 46849176 |
LOTUS | LTS0050873 |
wikiData | Q105023342 |