Isolespeol
Internal ID | 0f2e71a9-6697-4fe4-b666-ac68fc928ba8 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-1-[(2R)-7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | CC(=CCCC1(C=CC2=CC(=C(C=C2O1)O)C(=O)C=CC3=CC=C(C=C3)O)C)C |
SMILES (Isomeric) | CC(=CCC[C@@]1(C=CC2=CC(=C(C=C2O1)O)C(=O)/C=C/C3=CC=C(C=C3)O)C)C |
InChI | InChI=1S/C25H26O4/c1-17(2)5-4-13-25(3)14-12-19-15-21(23(28)16-24(19)29-25)22(27)11-8-18-6-9-20(26)10-7-18/h5-12,14-16,26,28H,4,13H2,1-3H3/b11-8+/t25-/m1/s1 |
InChI Key | GNSKDNKVOSRHRE-FPVCCHAOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H26O4 |
Molecular Weight | 390.50 g/mol |
Exact Mass | 390.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.40 |
(E)-1-[(2R)-7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.36% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.54% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.12% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.81% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.50% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.16% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.44% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 87.12% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.01% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.78% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.55% | 96.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.38% | 93.10% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.16% | 94.80% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.01% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.19% | 90.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.90% | 89.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.55% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 25111363 |
LOTUS | LTS0228147 |
wikiData | Q105013247 |