[(9S,10S)-10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate
Internal ID | 2b01ab0c-300b-49f3-8ea6-7d8806f62d06 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Angular pyranocoumarins |
IUPAC Name | [(9S,10S)-10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C2=C(C=CC3=C2OC(=O)C=C3)OC1(C)C)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@H](C2=C(C=CC3=C2OC(=O)C=C3)OC1(C)C)O |
InChI | InChI=1S/C19H20O6/c1-5-10(2)18(22)24-17-15(21)14-12(25-19(17,3)4)8-6-11-7-9-13(20)23-16(11)14/h5-9,15,17,21H,1-4H3/b10-5-/t15-,17-/m0/s1 |
InChI Key | KJWFOHVSTFGWGZ-ODZVBOMLSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 2.60 |
MLS000574889 |
CHEMBL1538873 |
HMS2228O24 |
SMR000156246 |
![2D Structure of [(9S,10S)-10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(9S,10S)-10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/07/isolaserpitin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
15848.9 nM |
Potency |
PMID: 18710917
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
PMID: 23411072
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
31622.8 nM |
Potency |
PMID: 23891163
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.31% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.38% | 83.82% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.76% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.20% | 95.56% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.01% | 85.30% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.88% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.75% | 94.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.75% | 81.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.63% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.93% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.14% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica keiskei |
PubChem | 15945056 |
NPASS | NPC152771 |
ChEMBL | CHEMBL1538873 |
LOTUS | LTS0193369 |
wikiData | Q104396951 |