Isofusicomycin A
| Internal ID | 6e2ab313-cfef-4cb7-a160-baaa33b94162 |
| Taxonomy | Organoheterocyclic compounds > Oxanes |
| IUPAC Name | [(2S)-2-[(1R,3R,6R,10S,11S,12R,14R)-10,12-dihydroxy-14-(hydroxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradec-7-enyl]propyl] (2R)-2-[(2R,3R,5R,6S)-2-hydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]propanoate |
| SMILES (Canonical) | CCC(=O)C(C)C1C(CC(C(O1)(C(C)C(=O)OCC(C)C2CCC3(C2=CCC(C4C(CC(C4C3)CO)O)(C)O)C)O)C)C |
| SMILES (Isomeric) | CCC(=O)[C@@H](C)[C@@H]1[C@@H](C[C@H]([C@@](O1)([C@@H](C)C(=O)OC[C@@H](C)[C@H]2CC[C@]3(C2=CC[C@]([C@@H]4[C@@H](C[C@H]([C@H]4C3)CO)O)(C)O)C)O)C)C |
| InChI | InChI=1S/C35H58O8/c1-9-28(37)22(5)31-19(2)14-21(4)35(41,43-31)23(6)32(39)42-18-20(3)25-10-12-33(7)16-26-24(17-36)15-29(38)30(26)34(8,40)13-11-27(25)33/h11,19-26,29-31,36,38,40-41H,9-10,12-18H2,1-8H3/t19-,20-,21-,22-,23+,24+,25-,26-,29-,30+,31+,33-,34+,35-/m1/s1 |
| InChI Key | HJMPLLRXUQKGPD-YAHGRDNBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H58O8 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.41316880 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 5.30 |
| [(2S)-2-[(1R,3R,6R,10S,11S,12R,14R)-10,12-dihydroxy-14-(hydroxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradec-7-enyl]propyl] (2R)-2-[(2R,3R,5R,6S)-2-hydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]propanoate |
| ((2S)-2-((1R,3R,6R,10S,11S,12R,14R)-10,12-dihydroxy-14-(hydroxymethyl)-3,10-dimethyl-6-tricyclo(9.3.0.03,7)tetradec-7-enyl)propyl) (2R)-2-((2R,3R,5R,6S)-2-hydroxy-3,5-dimethyl-6-((2S)-3-oxopentan-2-yl)oxan-2-yl)propanoate |
| (2S)-2-((1R,3R,6R,10S,11S,12R,14R)-10,12-Dihydroxy-14-(hydroxymethyl)-3,10-dimethyltricyclo(9.3.0.0,)tetradec-7-en-6-yl)propyl (2R)-2-((2R,3R,5R,6S)-2-hydroxy-3,5-dimethyl-6-((2S)-3-oxopentan-2-yl)oxan-2-yl)propanoic acid |
| (2S)-2-[(1R,3R,6R,10S,11S,12R,14R)-10,12-Dihydroxy-14-(hydroxymethyl)-3,10-dimethyltricyclo[9.3.0.0,]tetradec-7-en-6-yl]propyl (2R)-2-[(2R,3R,5R,6S)-2-hydroxy-3,5-dimethyl-6-[(2S)-3-oxopentan-2-yl]oxan-2-yl]propanoic acid |
| RefChem:149359 |
| CHEBI:206918 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.61% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.25% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.37% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.35% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.08% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.68% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.61% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.26% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.92% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.21% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.01% | 95.56% |
| CHEMBL5028 | O14672 | ADAM10 | 83.88% | 97.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.73% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.54% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.22% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.81% | 96.95% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.46% | 96.90% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.88% | 91.19% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.88% | 93.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.06% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589675 |
| LOTUS | LTS0094837 |
| wikiData | Q105029336 |