Isofuranonaphthoquinone D
| Internal ID | b8d0d438-199d-48f1-96d6-ff2eb93bdc27 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 5-hydroxy-6,7-dimethoxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H12O6/c1-6-10-8(5-21-6)12(16)7-4-9(19-2)15(20-3)14(18)11(7)13(10)17/h4-5,18H,1-3H3 |
| InChI Key | FSDLITFTXNPSSN-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 86.00 Ų |
| XlogP | 2.50 |
| 5-hydroxy-6,7-dimethoxy-3-methylbenzo(f)(2)benzofuran-4,9-dione |
| 5-hydroxy-6,7-dimethoxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
| RefChem:149356 |
| CHEBI:225914 |
| 5-hydroxy-6,7-dimethoxy-3-methylbenzo[][2]benzouran-4,9-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.11% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.30% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.40% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.45% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.31% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.23% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.19% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.83% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.79% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.29% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589411 |
| LOTUS | LTS0218150 |
| wikiData | Q104166731 |