Isoemericellin
| Internal ID | db56697d-3487-46ee-90a7-fb7671ac326d |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
| IUPAC Name | 8-hydroxy-1-(hydroxymethyl)-3-methyl-2-(3-methylbut-2-enoxy)-7-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES (Canonical) | CC1=CC2=C(C(=C1OCC=C(C)C)CO)C(=O)C3=C(O2)C=CC(=C3O)CC=C(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1OCC=C(C)C)CO)C(=O)C3=C(O2)C=CC(=C3O)CC=C(C)C |
| InChI | InChI=1S/C25H28O5/c1-14(2)6-7-17-8-9-19-22(23(17)27)24(28)21-18(13-26)25(29-11-10-15(3)4)16(5)12-20(21)30-19/h6,8-10,12,26-27H,7,11,13H2,1-5H3 |
| InChI Key | MDBQNLFOBADTEY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 6.00 |
| 8-hydroxy-1-(hydroxymethyl)-3-methyl-2-(3-methylbut-2-enoxy)-7-(3-methylbut-2-enyl)xanthen-9-one |
| 8-hydroxy-1-(hydroxymethyl)-3-methyl-7-(3-methylbut-2-en-1-yl)-2-[(3-methylbut-2-en-1-yl)oxy]-9H-xanthen-9-one |
| 8-Hydroxy-1-hydroxymethyl-3-methyl-7-(3-methyl-but-2-enyl)-2-(3-methyl-but-2-enyloxy)-xanthen-9-one |
| 9H-xanthen-9-one, 8-hydroxy-1-(hydroxymethyl)-3-methyl-7-(3-methyl-2-butenyl)-2-[(3-methyl-2-butenyl)oxy]- |
| 8-hydroxy-1-(hydroxymethyl)-3-methyl-7-(3-methylbut-2-en-1-yl)-2-((3-methylbut-2-en-1-yl)oxy)-9H-xanthen-9-one |
| 9H-xanthen-9-one, 8-hydroxy-1-(hydroxymethyl)-3-methyl-7-(3-methyl-2-butenyl)-2-((3-methyl-2-butenyl)oxy)- |
| RefChem:149315 |
| 594860-24-9 |
| InChI=1/C25H28O5/c1-14(2)6-7-17-8-9-19-22(23(17)27)24(28)21-18(13-26)25(29-11-10-15(3)4)16(5)12-20(21)30-19/h6,8-10,12,26-27H,7,11,13H2,1-5H |
| CHEBI:227314 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 97.34% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.12% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.58% | 89.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.71% | 89.34% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.54% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.13% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.62% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.46% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.81% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.01% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.85% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.79% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.41% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 637262 |
| LOTUS | LTS0128138 |
| wikiData | Q15426265 |