Isobutyramide
| Internal ID | 671b8b9e-5422-4bcd-83cd-fcb95e99abd6 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Primary carboxylic acid amides |
| IUPAC Name | 2-methylpropanamide |
| SMILES (Canonical) | CC(C)C(=O)N |
| SMILES (Isomeric) | CC(C)C(=O)N |
| InChI | InChI=1S/C4H9NO/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6) |
| InChI Key | WFKAJVHLWXSISD-UHFFFAOYSA-N |
| Popularity | 318 references in papers |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 43.10 Ų |
| XlogP | 0.20 |
| 563-83-7 |
| 2-Methylpropanamide |
| 2-Methylpropionamide |
| Propanamide, 2-methyl- |
| Isobutyrimidic acid |
| Isobutylamide |
| MFCD00008019 |
| 82UOE7B38Z |
| NSC-8423 |
| dimethylacetoamide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.04% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.86% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cedrela odorata |
| Dictamnus dasycarpus |
| Xylocarpus granatum |
| PubChem | 68424 |
| LOTUS | LTS0211565 |
| wikiData | Q105015530 |