Isobrucine
Internal ID | 0c2d3cf9-d8d3-40bc-8a05-ebb375f3b097 |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | (1R,13S,14E,19S,21S)-14-(2-hydroxyethylidene)-4,5-dimethoxy-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6,11-tetraen-9-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C34CCN5C3CC(C(=CCO)C5)C6=CCC(=O)N2C46)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)[C@]34CCN5[C@H]3C[C@@H](/C(=C\CO)/C5)C6=CCC(=O)N2[C@H]46)OC |
InChI | InChI=1S/C23H26N2O4/c1-28-18-10-16-17(11-19(18)29-2)25-21(27)4-3-14-15-9-20-23(16,22(14)25)6-7-24(20)12-13(15)5-8-26/h3,5,10-11,15,20,22,26H,4,6-9,12H2,1-2H3/b13-5-/t15-,20-,22-,23+/m0/s1 |
InChI Key | XTGYWZXUYFAABL-XZZOEZDBSA-N |
Popularity | 4 references in papers |
Molecular Formula | C23H26N2O4 |
Molecular Weight | 394.50 g/mol |
Exact Mass | 394.18925731 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 0.40 |
CHEMBL2164629 |
CHEBI:132660 |
(3aR,11bS,12S,13aS,14E)-14-(2-hydroxyethylidene)-5,6-dimethoxy-2,3,10,12,13,13a-hexahydro-9H,11bH-1,12-ethanopyrido[1,2,3-lm]pyrrolo[2,3-d]carbazol-9-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.41% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.92% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.43% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.46% | 86.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.85% | 91.03% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 90.64% | 82.38% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 90.29% | 96.76% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.97% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.36% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.33% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.84% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.25% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.44% | 91.07% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.76% | 90.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.11% | 91.19% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.04% | 89.50% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.63% | 92.38% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.43% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 80.20% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos nux-vomica |
PubChem | 56598205 |
LOTUS | LTS0168367 |
wikiData | Q105341556 |