Isoaurmillone
Internal ID | 22bb15a9-86d8-45c5-8449-aef5fa7145f0 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
IUPAC Name | 5,7-dihydroxy-6-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one |
SMILES (Canonical) | CC(=CCOC1=CC=C(C=C1)C2=COC3=C(C2=O)C(=C(C(=C3)O)OC)O)C |
SMILES (Isomeric) | CC(=CCOC1=CC=C(C=C1)C2=COC3=C(C2=O)C(=C(C(=C3)O)OC)O)C |
InChI | InChI=1S/C21H20O6/c1-12(2)8-9-26-14-6-4-13(5-7-14)15-11-27-17-10-16(22)21(25-3)20(24)18(17)19(15)23/h4-8,10-11,22,24H,9H2,1-3H3 |
InChI Key | LWYWLXANIDATEW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 4.50 |
5,7-Dihydroxy-6-methoxy-4'-prenyloxyisoflavone |
CHEBI:196980 |
LMPK12050382 |
5,7-dihydroxy-6-methoxy-3-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.00% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.53% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.99% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.80% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.88% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.78% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.78% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.54% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.31% | 96.12% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.88% | 94.75% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.83% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.04% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.99% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.68% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.43% | 93.31% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.34% | 85.14% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.49% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Millettia extensa |
PubChem | 44257351 |
LOTUS | LTS0115441 |
wikiData | Q105158677 |