Isoartocarpesin
Internal ID | 1c948f2f-ce70-4440-89a0-2e2f898dba38 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
IUPAC Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]chromen-4-one |
SMILES (Canonical) | CC(C)C=CC1=C(C2=C(C=C1O)OC(=CC2=O)C3=C(C=C(C=C3)O)O)O |
SMILES (Isomeric) | CC(C)/C=C/C1=C(C2=C(C=C1O)OC(=CC2=O)C3=C(C=C(C=C3)O)O)O |
InChI | InChI=1S/C20H18O6/c1-10(2)3-5-13-15(23)8-18-19(20(13)25)16(24)9-17(26-18)12-6-4-11(21)7-14(12)22/h3-10,21-23,25H,1-2H3/b5-3+ |
InChI Key | BEALEKDGCXYWLB-HWKANZROSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H18O6 |
Molecular Weight | 354.40 g/mol |
Exact Mass | 354.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 3.20 |
CHEBI:175539 |
2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]chromen-4-one |
2',4',5,7-Tetrahydroxy-6-(3-methyl-1-butenyl)flavone |
2',4',5,7-tetrahydroxy-6-[3-methyl-1(e)-butenyl]flavone |
2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(1E)-3-methylbut-1-en-1-yl]-4H-chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.67% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.25% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.43% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.15% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 91.53% | 98.35% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.56% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.62% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.53% | 94.73% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.22% | 85.11% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.83% | 83.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.44% | 86.33% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.34% | 93.10% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.19% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.80% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.28% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 10450773 |
LOTUS | LTS0214147 |
wikiData | Q76415689 |