Indolo(2,1-b)quinazoline-12-carboxylic acid, 6,12-dihydro-12-hydroxy-6-oxo-, methyl ester
| Internal ID | 65474d9f-0ea0-4ed5-ab30-72ed0d3f8f27 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines > Indoloquinazolines |
| IUPAC Name | methyl 12-hydroxy-6-oxoindolo[2,1-b]quinazoline-12-carboxylate |
| SMILES (Canonical) | COC(=O)C1(C2=CC=CC=C2N=C3N1C4=CC=CC=C4C3=O)O |
| SMILES (Isomeric) | COC(=O)C1(C2=CC=CC=C2N=C3N1C4=CC=CC=C4C3=O)O |
| InChI | InChI=1S/C17H12N2O4/c1-23-16(21)17(22)11-7-3-4-8-12(11)18-15-14(20)10-6-2-5-9-13(10)19(15)17/h2-9,22H,1H3 |
| InChI Key | KBIGHBLKYNEVDZ-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07970687 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 1.50 |
| 62584-11-6 |
| Indolo(2,1-b)quinazoline-12-carboxylic acid, 6,12-dihydro-12-hydroxy-6-oxo-, methyl ester |
| NSC675463 |
| NSC 675463 |
| Methyl 6,12-dihydro-12-hydroxy-6-oxoindolo(2, 1-b)quinazoline-12-carboxylate |
| Methyl 6,12-dihydro-12-hydroxy-6-oxoindolo[2, 1-b]quinazoline-12-carboxylate |
| CHEMBL511527 |
| NSC-675463 |
| Methyl 6,1-b]quinazoline-12-carboxylate |
| NCI60_026673 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.68% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.36% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.46% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.28% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.64% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.50% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.54% | 98.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.49% | 96.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.32% | 90.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.77% | 97.50% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.18% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phaius mishmensis |
| PubChem | 384867 |
| LOTUS | LTS0105186 |
| wikiData | Q104401476 |