Indole-3-glycerol phosphate
| Internal ID | f4ac72be-0dae-4eb8-9c4c-5c2d9ea595a8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | [(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] dihydrogen phosphate |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C(C(COP(=O)(O)O)O)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)[C@@H]([C@@H](COP(=O)(O)O)O)O |
| InChI | InChI=1S/C11H14NO6P/c13-10(6-18-19(15,16)17)11(14)8-5-12-9-4-2-1-3-7(8)9/h1-5,10-14H,6H2,(H2,15,16,17)/t10-,11+/m1/s1 |
| InChI Key | NQEQTYPJSIEPHW-MNOVXSKESA-N |
| Popularity | 46 references in papers |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.05587416 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | -1.20 |
| (1S,2R)-1-C-(Indol-3-yl)glycerol 3-phosphate |
| indoleglycerol phosphate |
| (3-Indolyl)-glycerol phosphate |
| (2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl dihydrogen phosphate |
| C1-(3-Indolyl)-glycerol 3-phosphate |
| CHEBI:51793 |
| DTXSID501344224 |
| [(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] dihydrogen phosphate |
| DB04143 |
| C03506 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.38% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.18% | 91.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.79% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.99% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.97% | 98.95% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.81% | 83.10% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.11% | 98.59% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.86% | 94.73% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 87.45% | 94.01% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 85.49% | 93.81% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.99% | 97.29% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.94% | 94.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.68% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.45% | 94.45% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.59% | 94.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.79% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 444150 |
| LOTUS | LTS0091517 |
| wikiData | Q27094983 |