Indole, 3-(2-(methylamino)ethyl)-1-methyl-
Internal ID | b368fc00-4de7-4273-893a-f7588dbf6961 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Tryptamines and derivatives |
IUPAC Name | N-methyl-2-(1-methylindol-3-yl)ethanamine |
SMILES (Canonical) | CNCCC1=CN(C2=CC=CC=C21)C |
SMILES (Isomeric) | CNCCC1=CN(C2=CC=CC=C21)C |
InChI | InChI=1S/C12H16N2/c1-13-8-7-10-9-14(2)12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
InChI Key | XUCUSHRCIKFRCK-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C12H16N2 |
Molecular Weight | 188.27 g/mol |
Exact Mass | 188.131348519 g/mol |
Topological Polar Surface Area (TPSA) | 17.00 Ų |
XlogP | 1.80 |
37637-29-9 |
BRN 0145930 |
3-(2-(Methylamino)ethyl)-1-methylindole |
N,N'-dimethyltryptamine |
SCHEMBL3257855 |
CHEMBL2036785 |
DTXSID90191072 |
AKOS013786341 |
methyl[2-(1-methyl-1H-indol-3-yl)ethyl]amine |
EN300-1842542 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.19% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.84% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.11% | 95.56% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 87.52% | 98.59% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 85.20% | 96.25% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.65% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.21% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.57% | 95.83% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.33% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.90% | 91.11% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.15% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bazzania trilobata |
Chimonanthus praecox |
Lepidozia incurvata |
PubChem | 37796 |
LOTUS | LTS0258206 |
wikiData | Q105247107 |