Incarvilone A
Internal ID | aa279378-a667-40dd-be28-29e5c7a6d5ae |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (4aR,5S)-3-[(2S)-1-hydroxypropan-2-yl]-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalen-1-one |
SMILES (Canonical) | CC1CCC=C2C1(CC(=CC2=O)C(C)CO)C |
SMILES (Isomeric) | C[C@H]1CCC=C2[C@@]1(CC(=CC2=O)[C@H](C)CO)C |
InChI | InChI=1S/C15H22O2/c1-10(9-16)12-7-14(17)13-6-4-5-11(2)15(13,3)8-12/h6-7,10-11,16H,4-5,8-9H2,1-3H3/t10-,11+,15-/m1/s1 |
InChI Key | OVQMVJMSOVOWOD-JRPNMDOOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22O2 |
Molecular Weight | 234.33 g/mol |
Exact Mass | 234.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 2.60 |
CHEMBL2062970 |
![2D Structure of Incarvilone A 2D Structure of Incarvilone A](https://plantaedb.com/storage/docs/compounds/2023/11/incarvilone-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.36% | 97.25% |
CHEMBL4072 | P07858 | Cathepsin B | 95.82% | 93.67% |
CHEMBL2581 | P07339 | Cathepsin D | 95.78% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.33% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.35% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.02% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.10% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.51% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.16% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.51% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.47% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.90% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.18% | 90.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.11% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Incarvillea diffusa |
PubChem | 70686503 |
LOTUS | LTS0126098 |
wikiData | Q105200918 |