Incarnatapeptin B
| Internal ID | 815c84ab-dd6f-43fb-8e02-d6faf309f223 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2S)-2-[(3R,5R)-3,5-dimethyl-2,6-dioxabicyclo[2.2.2]octan-1-yl]-2-hydroxy-N-[(3R,10S,13R,20S,21S,24S,27S)-11-hydroxy-24-[(1R)-1-hydroxyethyl]-10-methyl-2,9,12,19,23,26-hexaoxo-21-propan-2-yl-22-oxa-1,7,8,11,17,18,25,31-octazatetracyclo[25.4.0.03,8.013,18]hentriacontan-20-yl]propanamide |
| SMILES (Canonical) | CC1C2CCC(O1)(OC2C)C(C)(C(=O)NC3C(OC(=O)C(NC(=O)C4CCCNN4C(=O)C5CCCNN5C(=O)C(N(C(=O)C6CCCNN6C3=O)O)C)C(C)O)C(C)C)O |
| SMILES (Isomeric) | C[C@@H]1C2CCC(O1)(O[C@@H]2C)[C@@](C)(C(=O)N[C@H]3[C@@H](OC(=O)[C@@H](NC(=O)[C@@H]4CCCNN4C(=O)[C@H]5CCCNN5C(=O)[C@@H](N(C(=O)[C@H]6CCCNN6C3=O)O)C)[C@@H](C)O)C(C)C)O |
| InChI | InChI=1S/C39H63N9O13/c1-19(2)30-29(44-37(56)38(7,57)39-15-14-24(22(5)60-39)23(6)61-39)35(54)47-27(13-10-18-42-47)34(53)48(58)20(3)32(51)46-26(12-9-17-41-46)33(52)45-25(11-8-16-40-45)31(50)43-28(21(4)49)36(55)59-30/h19-30,40-42,49,57-58H,8-18H2,1-7H3,(H,43,50)(H,44,56)/t20-,21+,22+,23+,24?,25-,26+,27+,28-,29-,30-,38+,39?/m0/s1 |
| InChI Key | PPOCPQTXIGARKU-YKLWHMBGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C39H63N9O13 |
| Molecular Weight | 866.00 g/mol |
| Exact Mass | 865.45453310 g/mol |
| Topological Polar Surface Area (TPSA) | 281.00 Ų |
| XlogP | -0.10 |
| Atomic LogP (AlogP) | -2.31 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 5 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.8022 | 80.22% |
| Caco-2 | - | 0.8560 | 85.60% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Lysosomes | 0.4303 | 43.03% |
| OATP2B1 inhibitior | - | 0.7222 | 72.22% |
| OATP1B1 inhibitior | + | 0.8288 | 82.88% |
| OATP1B3 inhibitior | + | 0.9322 | 93.22% |
| MATE1 inhibitior | - | 0.8400 | 84.00% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.6853 | 68.53% |
| P-glycoprotein inhibitior | + | 0.7459 | 74.59% |
| P-glycoprotein substrate | + | 0.7791 | 77.91% |
| CYP3A4 substrate | + | 0.7061 | 70.61% |
| CYP2C9 substrate | - | 0.8059 | 80.59% |
| CYP2D6 substrate | - | 0.8575 | 85.75% |
| CYP3A4 inhibition | - | 0.8913 | 89.13% |
| CYP2C9 inhibition | - | 0.7766 | 77.66% |
| CYP2C19 inhibition | - | 0.7655 | 76.55% |
| CYP2D6 inhibition | - | 0.8910 | 89.10% |
| CYP1A2 inhibition | - | 0.8562 | 85.62% |
| CYP2C8 inhibition | + | 0.6127 | 61.27% |
| CYP inhibitory promiscuity | - | 0.9749 | 97.49% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8000 | 80.00% |
| Carcinogenicity (trinary) | Non-required | 0.4766 | 47.66% |
| Eye corrosion | - | 0.9799 | 97.99% |
| Eye irritation | - | 0.9059 | 90.59% |
| Skin irritation | - | 0.7590 | 75.90% |
| Skin corrosion | - | 0.9195 | 91.95% |
| Ames mutagenesis | - | 0.6664 | 66.64% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5289 | 52.89% |
| Micronuclear | + | 0.8100 | 81.00% |
| Hepatotoxicity | - | 0.5727 | 57.27% |
| skin sensitisation | - | 0.8327 | 83.27% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | + | 0.4695 | 46.95% |
| Acute Oral Toxicity (c) | III | 0.5815 | 58.15% |
| Estrogen receptor binding | + | 0.8254 | 82.54% |
| Androgen receptor binding | + | 0.7423 | 74.23% |
| Thyroid receptor binding | + | 0.5700 | 57.00% |
| Glucocorticoid receptor binding | + | 0.6770 | 67.70% |
| Aromatase binding | + | 0.6560 | 65.60% |
| PPAR gamma | + | 0.7678 | 76.78% |
| Honey bee toxicity | - | 0.7127 | 71.27% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | - | 0.5145 | 51.45% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.55% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.40% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.98% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 96.54% | 90.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.05% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.58% | 97.09% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 95.24% | 91.03% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 94.59% | 97.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.53% | 89.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.05% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.96% | 97.14% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.53% | 95.71% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.35% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.18% | 93.03% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.96% | 98.05% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.95% | 93.04% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.20% | 92.88% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.51% | 96.61% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.48% | 92.98% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.45% | 90.08% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.80% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.73% | 95.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.55% | 98.59% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.48% | 89.50% |
| CHEMBL4072 | P07858 | Cathepsin B | 85.88% | 93.67% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 85.83% | 80.71% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 84.97% | 82.50% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.28% | 97.05% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.20% | 93.56% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.68% | 89.05% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 83.53% | 98.99% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.07% | 91.19% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.91% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.61% | 95.56% |
| CHEMBL5028 | O14672 | ADAM10 | 82.53% | 97.50% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.38% | 94.78% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.00% | 97.86% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.05% | 98.03% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.87% | 98.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.85% | 95.50% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 80.15% | 94.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684658 |
| LOTUS | LTS0077872 |
| wikiData | Q105212985 |