Ifflaiamine
| Internal ID | 3b370665-f48c-47b1-b3f6-75953c7b2308 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
| IUPAC Name | 2,3,3,9-tetramethyl-2H-furo[2,3-b]quinolin-4-one |
| SMILES (Canonical) | CC1C(C2=C(O1)N(C3=CC=CC=C3C2=O)C)(C)C |
| SMILES (Isomeric) | CC1C(C2=C(O1)N(C3=CC=CC=C3C2=O)C)(C)C |
| InChI | InChI=1S/C15H17NO2/c1-9-15(2,3)12-13(17)10-7-5-6-8-11(10)16(4)14(12)18-9/h5-9H,1-4H3 |
| InChI Key | QLPMLMDURILOQO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.20 |
| 31520-95-3 |
| 2,3,3,9-Tetramethyl-2H-furo[2,3-b]quinolin-4-one |
| AKOS032949076 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.76% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.70% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.80% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.79% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.33% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.39% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.71% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.63% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.14% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.42% | 93.40% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.73% | 94.73% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.70% | 96.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.49% | 90.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.01% | 97.14% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 80.90% | 97.63% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 80.33% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Flindersia ifflana |
| Uvaria kweichowensis |
| Uvaria rufa |
| PubChem | 12310788 |
| LOTUS | LTS0228546 |
| wikiData | Q105205690 |