Icajine
Internal ID | e49c9ab3-31c4-4228-ac0c-e377d21168cf |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1S,10S,22R,23R,24S)-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14,16,18-tetraene-12,20-dione |
SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C(=CCOC5CC(=O)N4C6=CC=CC=C36)C1 |
SMILES (Isomeric) | CN1CC[C@]23[C@@H]4[C@H]5[C@@H](CC2=O)C(=CCO[C@H]5CC(=O)N4C6=CC=CC=C36)C1 |
InChI | InChI=1S/C22H24N2O3/c1-23-8-7-22-15-4-2-3-5-16(15)24-19(26)11-17-20(21(22)24)14(10-18(22)25)13(12-23)6-9-27-17/h2-6,14,17,20-21H,7-12H2,1H3/t14-,17-,20-,21-,22+/m0/s1 |
InChI Key | RNZRHJNFQWMXHB-ZXXLSYNSSA-N |
Popularity | 5 references in papers |
Molecular Formula | C22H24N2O3 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.17869263 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 0.30 |
5525-31-5 |
N-Methylpseudostrychnine |
16,19-Secostrychnidine-10,16-dione, 19-methyl- |
(1S,10S,22R,23R,24S)-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14,16,18-tetraene-12,20-dione |
19-methyl-16,19-seco-strychnidine-10,16-dione |
SCHEMBL1445138 |
CHEMBL2164624 |
CHEBI:132668 |
(4aR,6aS,12aS,12bR,12cS)-15-methyl-4a,5,12,12a,12b,12c-hexahydro-11H-6a,4-(ethanoiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthene-6,11(2H)-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 98.78% | 96.01% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.19% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.06% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 92.41% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.12% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.16% | 99.23% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.12% | 93.65% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.77% | 94.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.65% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.05% | 85.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.58% | 93.40% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.65% | 96.39% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.57% | 95.62% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 82.94% | 88.84% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.14% | 82.69% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.01% | 85.11% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.85% | 97.33% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.60% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
Strychnos nux-vomica |
PubChem | 3083907 |
LOTUS | LTS0182775 |
wikiData | Q104394065 |