Ibuprofen
| Internal ID | 501ace37-1dff-4ac9-8363-9566f7ef02f5 |
| Taxonomy | Phenylpropanoids and polyketides > Phenylpropanoic acids |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]propanoic acid |
| SMILES (Canonical) | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |
| SMILES (Isomeric) | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
| InChI Key | HEFNNWSXXWATRW-UHFFFAOYSA-N |
| Popularity | 36,372 references in papers |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.130679813 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 3.50 |
| Atomic LogP (AlogP) | 3.07 |
| H-Bond Acceptor | 1 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 4 |
| 15687-27-1 |
| 2-(4-Isobutylphenyl)propanoic acid |
| Motrin |
| Brufen |
| Advil |
| Nurofen |
| Nuprin |
| Dolgit |
| Liptan |
| Medipren |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9947 | 99.47% |
| Caco-2 | + | 0.9313 | 93.13% |
| Blood Brain Barrier | + | 0.8750 | 87.50% |
| Human oral bioavailability | + | 0.9143 | 91.43% |
| Subcellular localzation | Mitochondria | 0.6974 | 69.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9413 | 94.13% |
| OATP1B3 inhibitior | + | 0.9403 | 94.03% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | - | 0.8666 | 86.66% |
| P-glycoprotein inhibitior | - | 0.9785 | 97.85% |
| P-glycoprotein substrate | - | 0.9430 | 94.30% |
| CYP3A4 substrate | - | 0.7932 | 79.32% |
| CYP2C9 substrate | + | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8686 | 86.86% |
| CYP3A4 inhibition | - | 0.9655 | 96.55% |
| CYP2C9 inhibition | - | 0.9305 | 93.05% |
| CYP2C19 inhibition | - | 0.9881 | 98.81% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9045 | 90.45% |
| CYP2C8 inhibition | - | 0.9936 | 99.36% |
| CYP inhibitory promiscuity | - | 0.9691 | 96.91% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | + | 0.5398 | 53.98% |
| Carcinogenicity (trinary) | Non-required | 0.7313 | 73.13% |
| Eye corrosion | - | 0.7115 | 71.15% |
| Eye irritation | - | 0.5205 | 52.05% |
| Skin irritation | + | 0.7733 | 77.33% |
| Skin corrosion | + | 0.5953 | 59.53% |
| Ames mutagenesis | - | 0.9900 | 99.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6106 | 61.06% |
| Micronuclear | - | 0.9441 | 94.41% |
| Hepatotoxicity | + | 0.8625 | 86.25% |
| skin sensitisation | + | 0.7552 | 75.52% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | + | 0.8208 | 82.08% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | - | 0.8242 | 82.42% |
| Acute Oral Toxicity (c) | III | 0.8084 | 80.84% |
| Estrogen receptor binding | - | 0.9133 | 91.33% |
| Androgen receptor binding | - | 0.5951 | 59.51% |
| Thyroid receptor binding | - | 0.6868 | 68.68% |
| Glucocorticoid receptor binding | - | 0.9187 | 91.87% |
| Aromatase binding | - | 0.7391 | 73.91% |
| PPAR gamma | + | 0.5483 | 54.83% |
| Honey bee toxicity | - | 0.9639 | 96.39% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.9100 | 91.00% |
| Fish aquatic toxicity | + | 0.9534 | 95.34% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 |
33000 nM |
IC50 |
PMID: 16183274
|
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
17000 nM |
IC50 |
PMID: 9057869
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
2.8 nM |
Potency |
via Super-PRED
|
| CHEMBL221 | P23219 | Cyclooxygenase-1 |
6900 nM 290 nM 1860 nM 6300 nM 212 nM 212 nM 98.65 nM 3000 nM 3000 nM 3000 nM 11100 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 17517512
PMID: 23651359 PMID: 23651359 DOI: 10.1016/0960-894X(96)00097-2 via CMAUP via Super-PRED via Super-PRED PMID: 9719605 PMID: 9544212 PMID: 9544211 PMID: 9057869 |
| CHEMBL230 | P35354 | Cyclooxygenase-2 |
1100 nM 730 nM 1100 nM 4300 nM 1100 nM 100 nM 1100 nM 1100 nM 1100 nM 1100 nM 1400 nM 1100 nM 1100 nM 1100 nM 1350 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 26691756
via Super-PRED PMID: 26487917 PMID: 25221653 PMID: 22148253 PMID: 9057869 PMID: 19500994 PMID: 19884005 PMID: 20097072 PMID: 20202839 PMID: 21280601 PMID: 20576432 PMID: 23200247 PMID: 21641217 PMID: 22091869 |
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
50000 nM |
Ki |
PMID: 10956186
|
| CHEMBL2157 | P10145 | Interleukin-8 |
50 nM |
IC50 |
via Super-PRED
|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
223.9 nM 223.9 nM 223.9 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
| CHEMBL1293235 | P02545 | Prelamin-A/C |
5.6 nM 5.6 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL1641347 | Q4U2R8 | Solute carrier family 22 member 6 |
8000 nM |
IC50 |
PMID: 10991954
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.48% | 83.82% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.88% | 90.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.62% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.42% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.89% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.06% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.21% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.93% | 90.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.71% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.26% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia argyi |
| Artemisia montana |
| Artemisia princeps |