Hypoletin-7-O-|A-D-xylopyranoside
Internal ID | e976fc7d-4336-45d2-ba2f-510c394f4238 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-7-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1C(C(C(C(O1)OC2=C(C3=C(C(=C2)O)C(=O)C=C(O3)C4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=C(C3=C(C(=C2)O)C(=O)C=C(O3)C4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C20H18O11/c21-8-2-1-7(3-9(8)22)13-4-10(23)15-11(24)5-14(17(27)19(15)30-13)31-20-18(28)16(26)12(25)6-29-20/h1-5,12,16,18,20-22,24-28H,6H2/t12-,16+,18-,20+/m1/s1 |
InChI Key | JZTWSAIHBOFVRO-MINVPOHDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O11 |
Molecular Weight | 434.30 g/mol |
Exact Mass | 434.08491139 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.20 |
HY-N11495 |
HYPOLETIN-7-O-BETA-D-XYLOPYRANOSIDE |
CS-0648087 |
E80626 |
126771-28-6 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.24% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.04% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.71% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.84% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 92.23% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 90.93% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.51% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.01% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.63% | 95.89% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 86.93% | 89.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.77% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.37% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.90% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.63% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.48% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.04% | 86.92% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.31% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus communis var. depressa |
Libocedrus bidwillii |
PubChem | 21589942 |
LOTUS | LTS0163624 |
wikiData | Q105137579 |