Ac-Aib-Pro-Aib-Ala-Aib-Ala-Gln-Aib-Ile-Aib-Gly-Aib-Aib-Pro-Val-Aib-Aib-Gln-Gln-Leu-ol
| Internal ID | 18218d87-8d31-46e1-b69b-b29a22a84df5 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[2-[[(2S)-1-(2-acetamido-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-N-[1-[[(2S,3S)-1-[[1-[[2-[[1-[[1-[(2S)-2-[[(2S)-1-[[1-[[1-[[(2S)-5-amino-1-[[(2S)-5-amino-1-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]pentanediamide |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C2CCCN2C(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)CO)NC(=O)C(C)(C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@@H]2CCCN2C(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C88H151N23O24/c1-28-46(6)61(100-75(131)83(16,17)104-66(122)53(35-38-58(91)116)96-62(118)47(7)93-72(128)81(12,13)103-63(119)48(8)94-73(129)82(14,15)105-68(124)55-32-30-40-111(55)78(134)87(24,25)101-49(9)113)70(126)107-80(10,11)71(127)92-42-59(117)102-85(20,21)76(132)109-88(26,27)79(135)110-39-29-31-54(110)67(123)99-60(45(4)5)69(125)106-86(22,23)77(133)108-84(18,19)74(130)98-52(34-37-57(90)115)65(121)97-51(33-36-56(89)114)64(120)95-50(43-112)41-44(2)3/h44-48,50-55,60-61,112H,28-43H2,1-27H3,(H2,89,114)(H2,90,115)(H2,91,116)(H,92,127)(H,93,128)(H,94,129)(H,95,120)(H,96,118)(H,97,121)(H,98,130)(H,99,123)(H,100,131)(H,101,113)(H,102,117)(H,103,119)(H,104,122)(H,105,124)(H,106,125)(H,107,126)(H,108,133)(H,109,132)/t46-,47-,48-,50-,51-,52-,53-,54-,55-,60-,61-/m0/s1 |
| InChI Key | YXSAZMJJLKVLLL-MNLKCRSMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C88H151N23O24 |
| Molecular Weight | 1915.30 g/mol |
| Exact Mass | 1914.13023278 g/mol |
| Topological Polar Surface Area (TPSA) | 714.00 Ų |
| XlogP | -3.50 |
| Atomic LogP (AlogP) | -5.39 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 22 |
| Rotatable Bonds | 52 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7688 | 76.88% |
| Caco-2 | - | 0.8576 | 85.76% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.5571 | 55.71% |
| Subcellular localzation | Lysosomes | 0.6661 | 66.61% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8442 | 84.42% |
| OATP1B3 inhibitior | + | 0.9386 | 93.86% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9652 | 96.52% |
| P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
| P-glycoprotein substrate | + | 0.8641 | 86.41% |
| CYP3A4 substrate | + | 0.7327 | 73.27% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.5261 | 52.61% |
| CYP2C9 inhibition | - | 0.8902 | 89.02% |
| CYP2C19 inhibition | - | 0.7642 | 76.42% |
| CYP2D6 inhibition | - | 0.8894 | 88.94% |
| CYP1A2 inhibition | - | 0.8981 | 89.81% |
| CYP2C8 inhibition | + | 0.6610 | 66.10% |
| CYP inhibitory promiscuity | - | 0.9754 | 97.54% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7300 | 73.00% |
| Carcinogenicity (trinary) | Non-required | 0.6000 | 60.00% |
| Eye corrosion | - | 0.9799 | 97.99% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7837 | 78.37% |
| Skin corrosion | - | 0.8734 | 87.34% |
| Ames mutagenesis | - | 0.7300 | 73.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6973 | 69.73% |
| Micronuclear | + | 0.5900 | 59.00% |
| Hepatotoxicity | + | 0.5907 | 59.07% |
| skin sensitisation | - | 0.8785 | 87.85% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | - | 0.5697 | 56.97% |
| Acute Oral Toxicity (c) | III | 0.6627 | 66.27% |
| Estrogen receptor binding | - | 0.5699 | 56.99% |
| Androgen receptor binding | + | 0.7617 | 76.17% |
| Thyroid receptor binding | + | 0.7675 | 76.75% |
| Glucocorticoid receptor binding | + | 0.8358 | 83.58% |
| Aromatase binding | + | 0.8110 | 81.10% |
| PPAR gamma | + | 0.8064 | 80.64% |
| Honey bee toxicity | - | 0.7488 | 74.88% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | + | 0.5524 | 55.24% |
| Fish aquatic toxicity | - | 0.6701 | 67.01% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.79% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.64% | 96.61% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.89% | 98.94% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.86% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.83% | 98.33% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.28% | 94.66% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.08% | 95.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.82% | 96.31% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.31% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.18% | 93.56% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 96.95% | 92.38% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.94% | 100.00% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 96.40% | 87.16% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 96.32% | 99.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 96.29% | 91.19% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.23% | 95.17% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 95.93% | 92.12% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.74% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.63% | 97.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.55% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.34% | 98.05% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.02% | 98.24% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 94.29% | 97.43% |
| CHEMBL236 | P41143 | Delta opioid receptor | 94.22% | 99.35% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 94.02% | 97.29% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.00% | 96.67% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.97% | 96.03% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.63% | 95.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.43% | 97.14% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 93.32% | 96.67% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 93.26% | 95.38% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.12% | 100.00% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 93.00% | 96.28% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 92.89% | 97.47% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 92.75% | 94.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 92.61% | 88.42% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.36% | 89.63% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.32% | 82.69% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.24% | 97.64% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 92.14% | 83.14% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.98% | 97.23% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 91.53% | 97.64% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.21% | 97.29% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 91.07% | 98.89% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 90.98% | 97.50% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.86% | 94.50% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 90.22% | 86.67% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 88.88% | 93.33% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.48% | 92.86% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.36% | 83.10% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.25% | 93.00% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 88.23% | 98.33% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.21% | 97.50% |
| CHEMBL4801 | P29466 | Caspase-1 | 87.93% | 96.85% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.80% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.59% | 98.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.55% | 91.11% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.51% | 94.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.46% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.23% | 96.90% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 86.46% | 88.81% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 86.10% | 96.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 86.06% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.76% | 89.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.60% | 98.75% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.53% | 92.88% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.38% | 98.46% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.08% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.95% | 94.45% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 84.95% | 99.17% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.86% | 95.36% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.81% | 96.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.79% | 90.17% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 84.71% | 94.05% |
| CHEMBL3776 | Q14790 | Caspase-8 | 84.16% | 97.06% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.00% | 96.25% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.71% | 97.21% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.60% | 95.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.97% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.85% | 90.71% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 82.77% | 95.27% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 82.77% | 93.90% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.30% | 82.38% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.03% | 97.56% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 81.95% | 98.77% |
| CHEMBL5028 | O14672 | ADAM10 | 81.87% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.61% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.59% | 89.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.38% | 90.08% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.94% | 96.11% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.67% | 93.04% |
| CHEMBL3691 | Q13822 | Autotaxin | 80.58% | 96.39% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.52% | 99.00% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 80.33% | 95.52% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101639445 |
| LOTUS | LTS0116731 |
| wikiData | Q105368106 |