Hypelcin A
| Internal ID | 791c9815-b248-40d9-b299-3251c6b85e6e |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-2-[[2-[[2-[[(2S)-2-[[2-[[(2S)-1-(2-acetamido-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-N-[1-[[2-[[1-[[2-[[1-[[1-[(2S)-2-[[(2S)-1-[[1-[[1-[[(2S)-5-amino-1-[[(2S)-5-amino-1-[(1-hydroxy-4-methylpentan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]pentanediamide |
| SMILES (Canonical) | CC(C)CC(CO)NC(=O)C(CCC(=O)N)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C1CCCN1C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)CNC(=O)C(C)(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C2CCCN2C(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | C[C@@H](C(=O)NC(C)(C)C(=O)NCC(=O)N[C@@H](CCC(=O)N)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(C)(C)NC(=O)[C@@H]2CCCN2C(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C83H141N23O24/c1-42(2)37-46(41-107)91-60(116)47(29-32-52(84)109)93-61(117)48(30-33-53(85)110)94-70(126)79(15,16)103-72(128)81(19,20)102-65(121)58(43(3)4)95-63(119)50-27-25-35-105(50)74(130)83(23,24)104-71(127)80(17,18)98-57(114)40-88-66(122)75(7,8)97-56(113)39-89-68(124)77(11,12)100-62(118)49(31-34-54(86)111)92-55(112)38-87-67(123)76(9,10)99-59(115)44(5)90-69(125)78(13,14)101-64(120)51-28-26-36-106(51)73(129)82(21,22)96-45(6)108/h42-44,46-51,58,107H,25-41H2,1-24H3,(H2,84,109)(H2,85,110)(H2,86,111)(H,87,123)(H,88,122)(H,89,124)(H,90,125)(H,91,116)(H,92,112)(H,93,117)(H,94,126)(H,95,119)(H,96,108)(H,97,113)(H,98,114)(H,99,115)(H,100,118)(H,101,120)(H,102,121)(H,103,128)(H,104,127)/t44-,46?,47-,48-,49-,50-,51-,58-/m0/s1 |
| InChI Key | LZQRFWZUSRZHJS-HQAPROKWSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C83H141N23O24 |
| Molecular Weight | 1845.10 g/mol |
| Exact Mass | 1844.05198246 g/mol |
| Topological Polar Surface Area (TPSA) | 714.00 Ų |
| XlogP | -5.60 |
| Atomic LogP (AlogP) | -7.19 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 22 |
| Rotatable Bonds | 50 |
| Hypelcin-A |
| 69910-29-8 |
| Alamethicin I, 6-(2-methylalanine)-8-L-leucine-9-de-L-valine-12-(2-methylalanine)-13a-endo-(2-methylalanine)-18-L-glutamine-19-(N(1)-(1-(hydroxymethyl)-3-methylbutyl)-L-glutamamide)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7042 | 70.42% |
| Caco-2 | - | 0.8574 | 85.74% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Lysosomes | 0.6172 | 61.72% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8519 | 85.19% |
| OATP1B3 inhibitior | + | 0.9382 | 93.82% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9629 | 96.29% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8674 | 86.74% |
| CYP3A4 substrate | + | 0.7300 | 73.00% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.6824 | 68.24% |
| CYP2C9 inhibition | - | 0.9027 | 90.27% |
| CYP2C19 inhibition | - | 0.7624 | 76.24% |
| CYP2D6 inhibition | - | 0.9010 | 90.10% |
| CYP1A2 inhibition | - | 0.9393 | 93.93% |
| CYP2C8 inhibition | + | 0.6080 | 60.80% |
| CYP inhibitory promiscuity | - | 0.9845 | 98.45% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7600 | 76.00% |
| Carcinogenicity (trinary) | Non-required | 0.5954 | 59.54% |
| Eye corrosion | - | 0.9794 | 97.94% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7815 | 78.15% |
| Skin corrosion | - | 0.8771 | 87.71% |
| Ames mutagenesis | - | 0.6978 | 69.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6808 | 68.08% |
| Micronuclear | + | 0.5900 | 59.00% |
| Hepatotoxicity | + | 0.5282 | 52.82% |
| skin sensitisation | - | 0.8846 | 88.46% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.8000 | 80.00% |
| Mitochondrial toxicity | + | 0.6750 | 67.50% |
| Nephrotoxicity | - | 0.6616 | 66.16% |
| Acute Oral Toxicity (c) | III | 0.6645 | 66.45% |
| Estrogen receptor binding | - | 0.5192 | 51.92% |
| Androgen receptor binding | + | 0.7649 | 76.49% |
| Thyroid receptor binding | + | 0.7381 | 73.81% |
| Glucocorticoid receptor binding | + | 0.8076 | 80.76% |
| Aromatase binding | + | 0.7919 | 79.19% |
| PPAR gamma | + | 0.7937 | 79.37% |
| Honey bee toxicity | - | 0.7595 | 75.95% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | + | 0.5024 | 50.24% |
| Fish aquatic toxicity | - | 0.6097 | 60.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.44% | 96.61% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.22% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.68% | 98.33% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.59% | 95.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.36% | 98.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.75% | 96.09% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 97.29% | 92.38% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.35% | 99.35% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.35% | 94.66% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.71% | 91.19% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 95.65% | 87.16% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 95.61% | 96.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.22% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.04% | 96.47% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 95.04% | 96.28% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 94.73% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.69% | 97.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.67% | 95.17% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.61% | 98.05% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.57% | 97.25% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 94.52% | 99.77% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.50% | 98.24% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 94.02% | 95.38% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.93% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.62% | 97.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.45% | 82.69% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 93.16% | 96.67% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.91% | 96.31% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.86% | 100.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 92.47% | 83.14% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 92.34% | 95.71% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 92.04% | 83.10% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 91.97% | 97.50% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 91.87% | 98.89% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 91.64% | 96.67% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 91.39% | 86.67% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.97% | 88.42% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.83% | 94.45% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 90.59% | 99.17% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 90.59% | 93.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 90.53% | 98.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.44% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.40% | 93.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.07% | 97.23% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 89.56% | 97.29% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 89.17% | 98.33% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 88.87% | 97.43% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 88.62% | 92.12% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.60% | 97.64% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.57% | 89.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.43% | 99.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 87.41% | 94.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.18% | 96.90% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.11% | 97.47% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 86.85% | 92.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.73% | 90.71% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.38% | 89.63% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.95% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.70% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.60% | 94.33% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 85.09% | 95.36% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 85.05% | 81.29% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.81% | 96.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.77% | 96.38% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 84.76% | 94.05% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 84.69% | 98.77% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.47% | 97.50% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 84.10% | 93.90% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.04% | 97.29% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 83.94% | 98.57% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 83.77% | 89.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.58% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.51% | 98.46% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.36% | 96.67% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.28% | 96.25% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.18% | 90.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.97% | 95.89% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.92% | 93.10% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.32% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.10% | 95.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.71% | 97.21% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.63% | 82.38% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.61% | 95.83% |
| CHEMBL5028 | O14672 | ADAM10 | 81.56% | 97.50% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 81.54% | 92.80% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.45% | 90.08% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.10% | 99.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.68% | 97.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.50% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16132325 |
| LOTUS | LTS0172275 |
| wikiData | Q104247295 |