Hypecorinine
Internal ID | 52e276a8-59e2-4dbc-86d1-5a142805aac4 |
Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
IUPAC Name | 6-methylspiro[7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline-5,7'-9H-[1,3]dioxolo[4,5-h]isochromene]-6'-one |
SMILES (Canonical) | CN1CCC2=CC3=C(C=C2C14C(=O)C5=C(CO4)C6=C(C=C5)OCO6)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C=C2C14C(=O)C5=C(CO4)C6=C(C=C5)OCO6)OCO3 |
InChI | InChI=1S/C20H17NO6/c1-21-5-4-11-6-16-17(25-9-24-16)7-14(11)20(21)19(22)12-2-3-15-18(26-10-23-15)13(12)8-27-20/h2-3,6-7H,4-5,8-10H2,1H3 |
InChI Key | DFLLMUXSZJESOF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H17NO6 |
Molecular Weight | 367.40 g/mol |
Exact Mass | 367.10558726 g/mol |
Topological Polar Surface Area (TPSA) | 66.50 Ų |
XlogP | 2.50 |
41787-57-9 |
CHEMBL4173190 |
6-methylspiro[7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline-5,7'-9H-[1,3]dioxolo[4,5-h]isochromene]-6'-one |
BDBM50286644 |
AKOS040734918 |
FS-7674 |
![2D Structure of Hypecorinine 2D Structure of Hypecorinine](https://plantaedb.com/storage/docs/compounds/2023/11/hypecorinine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.62% | 83.82% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 99.01% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 98.75% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.15% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.43% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.87% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.35% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.69% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.47% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.21% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.85% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.98% | 94.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.46% | 90.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.03% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.57% | 93.04% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.80% | 96.39% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.72% | 97.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.49% | 93.99% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.42% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis incisa |
Hypecoum erectum |
Hypecoum lactiflorum |
Hypecoum procumbens |
Pteridophyllum racemosum |
PubChem | 13997263 |
LOTUS | LTS0167581 |
wikiData | Q104977983 |