Hymenolid
Internal ID | 0e22adc2-7533-4bff-95f4-ef1984e649a9 |
Taxonomy | Organoheterocyclic compounds > Oxanes |
IUPAC Name | (1S,3R,7R,9R,10S,12R,14R)-14-ethoxy-12-hydroxy-1,9-dimethyl-4-methylidene-6,13-dioxatricyclo[8.4.0.03,7]tetradecan-5-one |
SMILES (Canonical) | CCOC1C2(CC3C(CC(C2CC(O1)O)C)OC(=O)C3=C)C |
SMILES (Isomeric) | CCO[C@H]1[C@]2(C[C@H]3[C@@H](C[C@H]([C@@H]2C[C@@H](O1)O)C)OC(=O)C3=C)C |
InChI | InChI=1S/C17H26O5/c1-5-20-16-17(4)8-11-10(3)15(19)21-13(11)6-9(2)12(17)7-14(18)22-16/h9,11-14,16,18H,3,5-8H2,1-2,4H3/t9-,11-,12+,13-,14-,16-,17+/m1/s1 |
InChI Key | UIFSGDQXHQSWGC-WZGUIHEFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O5 |
Molecular Weight | 310.40 g/mol |
Exact Mass | 310.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 2.60 |
25062-29-7 |
Hymenoloide |
Hymenolid |
DTXSID30179758 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.45% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.78% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.41% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.75% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.74% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.25% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.75% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.91% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.53% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.44% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.60% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hymenoxys jamesii |
Hymenoxys richardsonii |
Psilostrophe cooperi |
PubChem | 186090 |
LOTUS | LTS0046168 |
wikiData | Q83050282 |