Hydroxyphenyl dihydroxyisoindolinone
| Internal ID | 1d32f8ca-de5d-4600-8d70-0da8c13f84ff |
| Taxonomy | Organoheterocyclic compounds > Isoindoles and derivatives > Isoindolines > Isoindolones |
| IUPAC Name | 4,6-dihydroxy-2-(4-hydroxyphenyl)-3H-isoindol-1-one |
| SMILES (Canonical) | C1C2=C(C=C(C=C2O)O)C(=O)N1C3=CC=C(C=C3)O |
| SMILES (Isomeric) | C1C2=C(C=C(C=C2O)O)C(=O)N1C3=CC=C(C=C3)O |
| InChI | InChI=1S/C14H11NO4/c16-9-3-1-8(2-4-9)15-7-12-11(14(15)19)5-10(17)6-13(12)18/h1-6,16-18H,7H2 |
| InChI Key | PFNJFMLPBCRODX-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 81.00 Ų |
| XlogP | 1.40 |
| Clitocybine A |
| Hydroxyphenyl dihydroxyisoindolinone |
| 1086908-58-8 |
| UNII-0I478BV4Y9 |
| 0I478BV4Y9 |
| 1H-Isoindol-1-one, 2,3-dihydro-4,6-dihydroxy-2-(4-hydroxyphenyl) |
| 1h-isoindol-1-one,2,3-dihydro-4,6-dihydroxy-2-(4-hydroxyphenyl)- |
| SCHEMBL13749090 |
| DTXSID90148708 |
| 4,6-dihydroxy-2-p-hydroxyphenyl-isoindol-1-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 98.57% | 93.40% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.14% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.41% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.09% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.66% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.49% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.30% | 98.75% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.78% | 96.12% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.46% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.40% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.79% | 99.23% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.01% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aspidosperma tomentosum |
| PubChem | 25112175 |
| LOTUS | LTS0180652 |
| wikiData | Q105343293 |