Hydroxymoloka'Iamine
| Internal ID | f3dbb56a-0409-4dff-997d-4647fd10bef1 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | 2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol |
| SMILES (Canonical) | C1=C(C=C(C(=C1Br)OCCCN)Br)C(CN)O |
| SMILES (Isomeric) | C1=C(C=C(C(=C1Br)OCCCN)Br)C(CN)O |
| InChI | InChI=1S/C11H16Br2N2O2/c12-8-4-7(10(16)6-15)5-9(13)11(8)17-3-1-2-14/h4-5,10,16H,1-3,6,14-15H2 |
| InChI Key | LDAZBBKQQALEAP-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H16Br2N2O2 |
| Molecular Weight | 368.06 g/mol |
| Exact Mass | 367.95580 g/mol |
| Topological Polar Surface Area (TPSA) | 81.50 Ų |
| XlogP | 0.90 |
| CHEMBL479055 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.65% | 99.17% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 93.22% | 87.45% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.84% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.94% | 94.73% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.63% | 93.18% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 87.19% | 97.23% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.92% | 90.24% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 86.12% | 93.81% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.87% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.47% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.66% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.54% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.29% | 89.62% |
| CHEMBL3891 | P07384 | Calpain 1 | 82.00% | 93.04% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.38% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25016152 |
| LOTUS | LTS0160082 |
| wikiData | Q105150134 |