Hydramacrophyllol B
Internal ID | 3cd58d7e-a02e-428d-bc16-5dd613e5e29d |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Benzofuranones |
IUPAC Name | (3S)-7-hydroxy-3-[(R)-hydroxy-(4-hydroxyphenyl)methyl]-3H-2-benzofuran-1-one |
SMILES (Canonical) | C1=CC2=C(C(=C1)O)C(=O)OC2C(C3=CC=C(C=C3)O)O |
SMILES (Isomeric) | C1=CC2=C(C(=C1)O)C(=O)O[C@@H]2[C@@H](C3=CC=C(C=C3)O)O |
InChI | InChI=1S/C15H12O5/c16-9-6-4-8(5-7-9)13(18)14-10-2-1-3-11(17)12(10)15(19)20-14/h1-7,13-14,16-18H/t13-,14+/m1/s1 |
InChI Key | FADYYEHFGLVECU-KGLIPLIRSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H12O5 |
Molecular Weight | 272.25 g/mol |
Exact Mass | 272.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 2.10 |
CHEBI:68135 |
Q27136627 |
(3S)-7-hydroxy-3-((R)-hydroxy(4-hydroxyphenyl)methyl)-isobenzofuran-1(3H)-one |
(3S)-7-hydroxy-3-[(R)-hydroxy(4-hydroxyphenyl)methyl]-2-benzofuran-1(3H)-one |
(3S)-7-hydroxy-3-[(R)-hydroxy-(4-hydroxyphenyl)methyl]-3H-2-benzofuran-1-one |
![2D Structure of Hydramacrophyllol B 2D Structure of Hydramacrophyllol B](https://plantaedb.com/storage/docs/compounds/2023/11/hydramacrophyllol-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.56% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.73% | 85.14% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 89.62% | 91.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.30% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.53% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.04% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.49% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.38% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.12% | 89.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 83.82% | 98.35% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.64% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.66% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 81.22% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.55% | 96.09% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.11% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hydrangea macrophylla |
Scorzonera psychrophila |
Scorzonera tomentosa |
PubChem | 10061772 |
LOTUS | LTS0213069 |
wikiData | Q27136627 |