Hyacinthacine C3
| Internal ID | 947167bb-360f-4878-b6c2-a5aeef7bd388 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
| IUPAC Name | (1S,2R,3R,5S,7R,8R)-3,5-bis(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H17NO5/c11-2-4-1-6(13)7-9(15)8(14)5(3-12)10(4)7/h4-9,11-15H,1-3H2/t4-,5+,6+,7+,8+,9-/m0/s1 |
| InChI Key | FKQQQROPNALGDM-ZLFMKPOPSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11067264 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | -2.30 |
| RefChem:146946 |
| (1S,2R,3R,5S,7R,8R)-3,5-bis(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| CHEMBL226683 |
| BDBM50214379 |
| [(1S*,2R*,3R*,5S*,7R*,7a*R)-3,5-dihydroxymethyl-1,2,7-trihydroxypyrrolizidine] |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.00% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.06% | 83.82% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.74% | 95.93% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 90.47% | 96.03% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 85.59% | 95.61% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.35% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ledebouria socialis |
| Scilla sodalicia |
| PubChem | 16737238 |
| NPASS | NPC141156 |
| ChEMBL | CHEMBL226683 |
| LOTUS | LTS0188165 |
| wikiData | Q104996749 |