Hueafuranoid A
Internal ID | 4fcc1ba6-c418-4bce-a473-ac8e556f0b9c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 6-hydroxy-6-[(2S,5R)-5-[(1E)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]-2-methylhept-2-en-4-one |
SMILES (Canonical) | CC(=CC(=O)CC(C)(C1CCC(O1)(C)C=CCC(C)(C=C)O)O)C |
SMILES (Isomeric) | CC(=CC(=O)CC(C)([C@@H]1CC[C@](O1)(C)/C=C/CC(C)(C=C)O)O)C |
InChI | InChI=1S/C20H32O4/c1-7-18(4,22)10-8-11-19(5)12-9-17(24-19)20(6,23)14-16(21)13-15(2)3/h7-8,11,13,17,22-23H,1,9-10,12,14H2,2-6H3/b11-8+/t17-,18?,19-,20?/m0/s1 |
InChI Key | HYSXHSFJFJWWOB-DQQJITHMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H32O4 |
Molecular Weight | 336.50 g/mol |
Exact Mass | 336.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.50 |
Hueafuranoid A |
Rel-Hueafuranoid A |
BDBM50402672 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.53% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.37% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.08% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.90% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.24% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.85% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.31% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 84.42% | 97.50% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.94% | 90.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.83% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.65% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.53% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.20% | 92.62% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.59% | 97.28% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 81.49% | 91.67% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.37% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.74% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum henryi |
PubChem | 71461461 |
LOTUS | LTS0122874 |
wikiData | Q105016982 |