Hoodigoside E
Internal ID | 63b3a9cc-a5c1-4a80-9aff-163f4af6c2bf |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8R,9S,10R,12R,13S,14S,17S)-17-acetyl-14-hydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4R,5R,6R)-3-hydroxy-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2C(CC=C3C2(CCC(C3)OC4CC(C(C(O4)C)OC5CC(C(C(O5)C)OC6C(C(C(C(O6)C)OC7C(C(C(C(O7)CO)O)O)O)OC)O)OC)OC)C)C8(C1(C(CC8)C(=O)C)C)O |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1C[C@H]2[C@@H](CC=C3[C@@]2(CC[C@@H](C3)O[C@H]4C[C@@H]([C@@H]([C@H](O4)C)O[C@H]5C[C@@H]([C@@H]([C@H](O5)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)OC)O)OC)OC)C)[C@@]8([C@]1([C@H](CC8)C(=O)C)C)O |
InChI | InChI=1S/C53H84O20/c1-12-24(2)48(60)70-37-20-33-32(53(61)18-16-31(25(3)55)52(37,53)8)14-13-29-19-30(15-17-51(29,33)7)68-38-21-34(62-9)44(26(4)65-38)71-39-22-35(63-10)45(27(5)66-39)72-50-43(59)47(64-11)46(28(6)67-50)73-49-42(58)41(57)40(56)36(23-54)69-49/h12-13,26-28,30-47,49-50,54,56-59,61H,14-23H2,1-11H3/b24-12+/t26-,27-,28-,30+,31-,32-,33+,34+,35+,36-,37-,38+,39+,40-,41+,42-,43-,44-,45-,46-,47-,49+,50+,51+,52+,53+/m1/s1 |
InChI Key | AACVPYUISGWNOU-NSVMOENNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H84O20 |
Molecular Weight | 1041.20 g/mol |
Exact Mass | 1040.55559506 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of Hoodigoside E 2D Structure of Hoodigoside E](https://plantaedb.com/storage/docs/compounds/2023/11/hoodigoside-e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.90% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.47% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.89% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.95% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.93% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.49% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.32% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.42% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 88.04% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.01% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.96% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.16% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.17% | 95.56% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.55% | 91.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.03% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 81.89% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.85% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.40% | 97.25% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.61% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hoodia gordonii |
Polyspora chrysandra |
PubChem | 16733367 |
LOTUS | LTS0181215 |
wikiData | Q104907830 |