Honyumine
Internal ID | a01d0c8b-5ba8-4ba6-a9cf-a5581bc1b89b |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
IUPAC Name | 5,9-dihydroxy-10-methoxy-2,2,11-trimethylpyrano[3,2-b]acridin-6-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(N3C)C(=C(C=C4)O)OC)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(N3C)C(=C(C=C4)O)OC)C |
InChI | InChI=1S/C20H19NO5/c1-20(2)8-7-10-14(26-20)9-12-15(17(10)23)18(24)11-5-6-13(22)19(25-4)16(11)21(12)3/h5-9,22-23H,1-4H3 |
InChI Key | DCEKPLXGLUMXMB-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H19NO5 |
Molecular Weight | 353.40 g/mol |
Exact Mass | 353.12632271 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 3.80 |
SJW3UM0K3D |
UNII-SJW3UM0K3D |
100595-86-6 |
10-Methoxy-2,2,11-trimethyl-5,9-bis(oxidanyl)pyrano(3,2-b)acridin-6-one |
2,11-Dihydro-5,9-dihydroxy-10-methoxy-2,2,11-trimethyl-6H-pyrano(3,2-b)acridin-6-one |
6H-Pyrano(3,2-b)acridin-6-one, 2,11-dihydro-5,9-dihydroxy-10-methoxy-2,2,11-trimethyl- |
2,11-Dihydro-5,9-dihydroxy-10-methoxy-2,2,11-trimethyl-6H-pyrano[3,2-b]acridin-6-one |
CHEBI:174756 |
DTXSID001128683 |
5,9-dihydroxy-10-methoxy-2,2,11-trimethylpyrano[3,2-b]acridin-6-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.12% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.33% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.23% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.18% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.81% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.82% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.18% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.10% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.52% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.15% | 85.14% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.11% | 80.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.91% | 86.33% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.91% | 94.42% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.51% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.11% | 99.23% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.55% | 96.77% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.95% | 94.75% |
CHEMBL2535 | P11166 | Glucose transporter | 80.54% | 98.75% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.34% | 93.65% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus maxima |
PubChem | 13965865 |
LOTUS | LTS0126219 |
wikiData | Q104396586 |