Hiroshidine
| Internal ID | 010d4b1c-d2bc-4248-bbbd-dfab5d9ee7b9 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | methyl 2-[(9S,11R,13R,14S)-7,9,14-trihydroxy-4-[(2R,5R)-5-[(1S)-1-hydroxyethyl]-1-methylpyrrolidin-2-yl]-11-methyl-2-oxo-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3,5,7-trien-13-yl]acetate |
| SMILES (Canonical) | CC1C23C(C4=C(C=CC(=C4C(=O)C2(O3)C(C(O1)CC(=O)OC)O)C5CCC(N5C)C(C)O)O)O |
| SMILES (Isomeric) | C[C@@H]1C23[C@H](C4=C(C=CC(=C4C(=O)C2(O3)[C@H]([C@H](O1)CC(=O)OC)O)[C@H]5CC[C@@H](N5C)[C@H](C)O)O)O |
| InChI | InChI=1S/C24H31NO9/c1-10(26)13-6-7-14(25(13)3)12-5-8-15(27)19-18(12)21(30)24-20(29)16(9-17(28)32-4)33-11(2)23(24,34-24)22(19)31/h5,8,10-11,13-14,16,20,22,26-27,29,31H,6-7,9H2,1-4H3/t10-,11+,13+,14+,16+,20-,22-,23?,24?/m0/s1 |
| InChI Key | OEVGTSXRJTXTAO-YKAORXRISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H31NO9 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.19988157 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.70% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.21% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.07% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.41% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.32% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.45% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.41% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.98% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.19% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.12% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.97% | 91.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.37% | 99.15% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.04% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.77% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.49% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.29% | 95.93% |
| CHEMBL5028 | O14672 | ADAM10 | 84.22% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.12% | 91.19% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.02% | 95.34% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.74% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682338 |
| LOTUS | LTS0221001 |
| wikiData | Q105190583 |