Hexaricin F
| Internal ID | 098d32b1-add7-41ac-891b-b82ed95024e1 |
| Taxonomy | Benzenoids > Naphthacenes > Tetracenequinones |
| IUPAC Name | 3,7,19,26-tetrahydroxy-15-methoxy-7-methyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2,4(9),10,15,18(23),19,21,25-nonaene-5,17,24-trione |
| SMILES (Canonical) | CC1(CC2=C(C(=C3C(=C2)CCC4=C3C(=C5C(=C4OC)C(=O)C6=C(C5=O)C=CC=C6O)O)O)C(=O)O1)O |
| SMILES (Isomeric) | CC1(CC2=C(C(=C3C(=C2)CCC4=C3C(=C5C(=C4OC)C(=O)C6=C(C5=O)C=CC=C6O)O)O)C(=O)O1)O |
| InChI | InChI=1S/C27H20O9/c1-27(34)9-11-8-10-6-7-13-18(15(10)22(30)16(11)26(33)36-27)24(32)19-20(25(13)35-2)23(31)17-12(21(19)29)4-3-5-14(17)28/h3-5,8,28,30,32,34H,6-7,9H2,1-2H3 |
| InChI Key | AYBHTJJOVGKNFS-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H20O9 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.11073221 g/mol |
| Topological Polar Surface Area (TPSA) | 151.00 Ų |
| XlogP | 4.90 |
| CHEMBL4210029 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.48% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.88% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.33% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.54% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.30% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.91% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.83% | 96.09% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 90.61% | 81.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.42% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.14% | 93.99% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.95% | 94.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.10% | 99.15% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.94% | 91.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.90% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.58% | 90.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.49% | 96.67% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 84.67% | 91.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.17% | 93.40% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.33% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.72% | 94.45% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.12% | 93.03% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.81% | 96.38% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.58% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590139 |
| LOTUS | LTS0130850 |
| wikiData | Q103816533 |