Hexadecyl 3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate
Internal ID | 79cdbec0-dd99-446f-991a-8c74f0654a61 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acids |
IUPAC Name | hexadecyl 3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCOC(=O)C=CC1=C(C=C(C=C1)OC)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCOC(=O)C=CC1=C(C=C(C=C1)OC)O |
InChI | InChI=1S/C26H42O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-30-26(28)20-18-23-17-19-24(29-2)22-25(23)27/h17-20,22,27H,3-16,21H2,1-2H3 |
InChI Key | MCCOHOMYYHZPDM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H42O4 |
Molecular Weight | 418.60 g/mol |
Exact Mass | 418.30830982 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 9.60 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.97% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.92% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.10% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.32% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.69% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.68% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 89.59% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.67% | 91.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.85% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.76% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.08% | 90.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.62% | 80.78% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.36% | 89.63% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.78% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.82% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Raputia praetermissa |
PubChem | 162974851 |
LOTUS | LTS0169080 |
wikiData | Q105161098 |