Herqueioxazole
| Internal ID | 996e62fb-dd81-446c-95c7-cd94cf6b7fef |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (15S,17S)-9,17-dihydroxy-5,11,15,16,16-pentamethyl-6,14-dioxa-4-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-1(19),3(7),4,8,10,12-hexaene-2,18-dione |
| SMILES (Canonical) | CC1C(C2(C(=C3C(=CC(=C4C3=C(C2=O)C(=O)C5=C4OC(=N5)C)O)C)O1)O)(C)C |
| SMILES (Isomeric) | C[C@H]1C([C@@]2(C(=C3C(=CC(=C4C3=C(C2=O)C(=O)C5=C4OC(=N5)C)O)C)O1)O)(C)C |
| InChI | InChI=1S/C21H19NO6/c1-7-6-10(23)12-13-11(7)19-21(26,20(4,5)8(2)27-19)18(25)14(13)16(24)15-17(12)28-9(3)22-15/h6,8,23,26H,1-5H3/t8-,21+/m0/s1 |
| InChI Key | HYEFHQJWCGRMCN-HXNGOWOSSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.12123733 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 1.10 |
| (15S,17S)-9,17-dihydroxy-5,11,15,16,16-pentamethyl-6,14-dioxa-4-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-1(19),3(7),4,8,10,12-hexaene-2,18-dione |
| (15S,17S)-9,17-dihydroxy-5,11,15,16,16-pentamethyl-6,14-dioxa-4-azapentacyclo(10.6.1.03,7.08,19.013,17)nonadeca-1(19),3(7),4,8,10,12-hexaene-2,18-dione |
| RefChem:145819 |
| CHEBI:189239 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.13% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.78% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.44% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.60% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.47% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.92% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.34% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.17% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.72% | 94.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.08% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.85% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.68% | 96.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.50% | 93.03% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.75% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.04% | 93.10% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.55% | 96.90% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.18% | 98.95% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.29% | 94.42% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.83% | 86.33% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.36% | 96.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.12% | 95.64% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.03% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 136218794 |
| LOTUS | LTS0125667 |
| wikiData | Q77370512 |